loading...| Preferred Name |
selenocysteine |
| Synonyms |
Selenocysteine Selenocystein Selenozystein 3-selenoalanine 2-amino-3-selanylpropanoic acid |
| Definitions |
An alpha-amino acid that consists of alanine where one of the methyl hydrogens is substituted with a seleno group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_9093 |
| charge |
0 |
| database_cross_reference |
PMID:21564332 MetaCyc:CPD0-1561 Reaxys:2498377 CAS:3614-08-2 Beilstein:2498377 DrugBank:DB02345 PMID:21213257 PMID:21856085 |
| definition |
An alpha-amino acid that consists of alanine where one of the methyl hydrogens is substituted with a seleno group. |
| formula |
C3H7NO2Se |
| has part | |
| has role | |
| has_exact_synonym |
Selenocysteine 2-amino-3-selanylpropanoic acid |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Selenocystein Selenozystein 3-selenoalanine |
| id |
CHEBI:9093 |
| in_subset | |
| inchi |
InChI=1S/C3H7NO2Se/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) |
| inchikey |
ZKZBPNGNEQAJSX-UHFFFAOYSA-N |
| is conjugate acid of | |
| is conjugate base of | |
| label |
selenocysteine |
| mass |
168.05322 |
| monoisotopicmass |
168.96420 |
| notation |
CHEBI:9093 |
| prefLabel |
selenocysteine |
| smiles |
NC(C[SeH])C(O)=O |
| treeView | |
| subClassOf |