loading...| Preferred Name |
pentafluorobenzoyl chloride |
| Synonyms |
pentafluorobenzoyl chloride 2,3,4,5,6-pentafluorobenzoyl chloride |
| Definitions |
The acid chloride of pentafluorobenzoic acid. It is a sensitive derivatising reagent for the analysis of amines, amides and phenols by electron capture gas chromatography. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_39425 |
| charge |
0 |
| database_cross_reference |
Beilstein:2054397 CAS:2251-50-5 |
| definition |
The acid chloride of pentafluorobenzoic acid. It is a sensitive derivatising reagent for the analysis of amines, amides and phenols by electron capture gas chromatography. |
| formula |
C7ClF5O |
| has functional parent | |
| has role | |
| has_exact_synonym |
pentafluorobenzoyl chloride |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
2,3,4,5,6-pentafluorobenzoyl chloride |
| id |
CHEBI:39425 |
| in_subset | |
| inchi |
InChI=1S/C7ClF5O/c8-7(14)1-2(9)4(11)6(13)5(12)3(1)10 |
| inchikey |
MYHOHFDYWMPGJY-UHFFFAOYSA-N |
| label |
pentafluorobenzoyl chloride |
| mass |
230.51900 |
| monoisotopicmass |
229.95578 |
| notation |
CHEBI:39425 |
| prefLabel |
pentafluorobenzoyl chloride |
| smiles |
Fc1c(F)c(F)c(C(Cl)=O)c(F)c1F |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C014737 | Medical Subject Headings / 医学主题词表 | LOOM |