loading...| Preferred Name |
alminoprofen |
| Synonyms |
alminoprofene 2-{4-[(2-methylprop-2-en-1-yl)amino]phenyl}propionic acid Minalfen p-((2-Methylallyl)amino)hydratropic acid alminoprofenum alminoprofen EB 382 EB-382 2-(4-((2-Methylallyl)amino)phenyl)propansaeure acide (methallylamino-4 phenyl)-2 propionique p-((2-methylallyl)amino)hydratropic acid alpha-methyl-4-[(2-methyl-2-propenyl)amino]benzeneacetic acid alminoprofeno 2-{4-[(2-methylprop-2-en-1-yl)amino]phenyl}propanoic acid BRN 2373633 |
| Definitions |
A substituted aniline that is ibuprofen in which the isobutyl group is replaced by a (2-methylprop-2-en-1-yl)amino group. A non-steroidal anti-inflammatory drug, it is used for treatment of inflammatory and rheumatic disorders. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_31190 |
| charge |
0 |
| database_cross_reference |
Patent:FR2137211 PMID:23306154 PMID:2076851 Wikipedia:Alminoprofen PMID:9933032 CAS:39718-89-3 PMID:4066887 KEGG:D01513 Drug_Central:126 PMID:1783327 PMID:24036363 Patent:US3957850 |
| definition |
A substituted aniline that is ibuprofen in which the isobutyl group is replaced by a (2-methylprop-2-en-1-yl)amino group. A non-steroidal anti-inflammatory drug, it is used for treatment of inflammatory and rheumatic disorders. |
| formula |
C13H17NO2 |
| has role |
http://purl.obolibrary.org/obo/CHEBI_35475 http://purl.obolibrary.org/obo/CHEBI_64964 http://purl.obolibrary.org/obo/CHEBI_50469 http://purl.obolibrary.org/obo/CHEBI_35493 http://purl.obolibrary.org/obo/CHEBI_35481 |
| has_exact_synonym |
2-{4-[(2-methylprop-2-en-1-yl)amino]phenyl}propanoic acid |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
alminoprofene 2-{4-[(2-methylprop-2-en-1-yl)amino]phenyl}propionic acid Minalfen p-((2-Methylallyl)amino)hydratropic acid alminoprofenum alminoprofen EB 382 EB-382 2-(4-((2-Methylallyl)amino)phenyl)propansaeure acide (methallylamino-4 phenyl)-2 propionique p-((2-methylallyl)amino)hydratropic acid alpha-methyl-4-[(2-methyl-2-propenyl)amino]benzeneacetic acid alminoprofeno BRN 2373633 |
| id |
CHEBI:31190 |
| in_subset | |
| inchi |
InChI=1S/C13H17NO2/c1-9(2)8-14-12-6-4-11(5-7-12)10(3)13(15)16/h4-7,10,14H,1,8H2,2-3H3,(H,15,16) |
| inchikey |
FPHLBGOJWPEVME-UHFFFAOYSA-N |
| label |
alminoprofen |
| mass |
219.27960 |
| monoisotopicmass |
219.12593 |
| notation |
CHEBI:31190 |
| prefLabel |
alminoprofen |
| smiles |
CC(C(O)=O)c1ccc(NCC(C)=C)cc1 |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_25384 http://purl.obolibrary.org/obo/CHEBI_50995 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_25384 http://purl.obolibrary.org/obo/CHEBI_50995 |