loading...| Preferred Name |
(R)-adrenaline(1+) |
| Synonyms |
(2R)-2-(3,4-dihydroxyphenyl)-2-hydroxy-N-methylethanaminium L-epinephrine(1+) (R)-adrenaline L-epinephrine cation (R)-adrenaline cation |
| Definitions |
An organic cation that is the conjugate acid of (R)-adrenaline, obtained by protonation of the amino group; major species at pH 7.3. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_71406 |
| charge |
+1 |
| database_cross_reference |
MetaCyc:L-EPINEPHRINE |
| definition |
An organic cation that is the conjugate acid of (R)-adrenaline, obtained by protonation of the amino group; major species at pH 7.3. |
| formula |
C9H14NO3 |
| has role | |
| has_exact_synonym |
(2R)-2-(3,4-dihydroxyphenyl)-2-hydroxy-N-methylethanaminium |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
L-epinephrine(1+) (R)-adrenaline L-epinephrine cation (R)-adrenaline cation |
| id |
CHEBI:71406 |
| in_subset | |
| inchi |
InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/p+1/t9-/m0/s1 |
| inchikey |
UCTWMZQNUQWSLP-VIFPVBQESA-O |
| is conjugate acid of | |
| label |
(R)-adrenaline(1+) |
| mass |
184.21240 |
| monoisotopicmass |
184.09682 |
| notation |
CHEBI:71406 |
| prefLabel |
(R)-adrenaline(1+) |
| smiles |
C[NH2+]C[C@H](O)c1ccc(O)c(O)c1 |
| treeView | |
| subClassOf |