| Preferred Name |
asparagine |
| Synonyms |
asparagina ASN 2,4-diamino-4-oxobutanoic acid N 2-amino-3-carbamoylpropanoic acid asparagine Asn Asparagin Hasp DL-Asparagine |
| Definitions |
An alpha-amino acid in which one of the hydrogens attached to the alpha-carbon of glycine is substituted by a 2-amino-2-oxoethyl group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_22653 |
| charge |
0 |
| database_cross_reference |
PMID:22770225 Gmelin:279043 Wikipedia:Asparagine Reaxys:1723525 PMID:22264337 CAS:3130-87-8 Beilstein:1723525 KEGG:C16438 |
| formula |
C4H8N2O3 |
| has exact synonym |
asparagine |
| has role | |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
asparagina ASN 2,4-diamino-4-oxobutanoic acid N 2-amino-3-carbamoylpropanoic acid Asn Asparagin Hasp DL-Asparagine |
| id |
CHEBI:22653 |
| imported from | |
| in subset | |
| inchi |
InChI=1S/C4H8N2O3/c5-2(4(8)9)1-3(6)7/h2H,1,5H2,(H2,6,7)(H,8,9) |
| inchikey |
DCXYFEDJOCDNAF-UHFFFAOYSA-N |
| is conjugate acid of | |
| is conjugate base of | |
| label |
asparagine |
| mass |
132.11800 |
| monoisotopicmass |
132.05349 |
| notation |
CHEBI:22653 |
| prefLabel |
asparagine |
| smiles |
NC(CC(N)=O)C(O)=O |
| textual definition |
An alpha-amino acid in which one of the hydrogens attached to the alpha-carbon of glycine is substituted by a 2-amino-2-oxoethyl group. |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26167 |
| has_part |