| Preferred Name |
2-amino-3-methylpentanoic acid |
| Synonyms |
2-amino-3-methylpentanoic acid |
| Definitions |
A branched chain amino acid that consists of 3-methylpentanoic acid bearing an amino substituent at position 2. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_38264 |
| charge |
0 |
| database_cross_reference |
CAS:443-79-8 Reaxys:1721790 KEGG:C16434 PMID:10944265 |
| formula |
C6H13NO2 |
| has exact synonym |
2-amino-3-methylpentanoic acid |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:38264 |
| imported from | |
| in subset | |
| inchi |
InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) |
| inchikey |
AGPKZVBTJJNPAG-UHFFFAOYSA-N |
| label |
2-amino-3-methylpentanoic acid |
| mass |
131.17296 |
| monoisotopicmass |
131.09463 |
| notation |
CHEBI:38264 |
| prefLabel |
2-amino-3-methylpentanoic acid |
| smiles |
CCC(C)C(N)C(O)=O |
| textual definition |
A branched chain amino acid that consists of 3-methylpentanoic acid bearing an amino substituent at position 2. |
| subClassOf |