Jump to:
loading...| Preferred Name |
valproate |
| Synonyms |
dipropylacetate 2-propylvalerate 2-propylpentanoate |
| Definitions |
A branched-chain saturated fatty acid anion that is the conjugate base of valproic acid. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_60654 |
| charge |
-1 |
| database_cross_reference |
LINCS:LSM-6363 PMID:20633966 PMID:21472635 PMID:16012283 PMID:21243535 PMID:21767635 PMID:8681902 PMID:21593515 PMID:21167688 PMID:21459656 PMID:21454832 PMID:21161183 PMID:21629819 |
| formula |
C8H15O2 |
| has exact synonym |
2-propylpentanoate |
| has functional parent | |
| has role | |
| has_alternative_id |
CHEBI:68615 |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
dipropylacetate 2-propylvalerate |
| id |
CHEBI:60654 |
| imported from | |
| in subset | |
| inchi |
InChI=1S/C8H16O2/c1-3-5-7(6-4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10)/p-1 |
| inchikey |
NIJJYAXOARWZEE-UHFFFAOYSA-M |
| is conjugate base of | |
| label |
valproate |
| mass |
143.20350 |
| monoisotopicmass |
143.10775 |
| notation |
CHEBI:60654 |
| prefLabel |
valproate |
| smiles |
CCCC(CCC)C([O-])=O |
| textual definition |
A branched-chain saturated fatty acid anion that is the conjugate base of valproic acid. |
| subClassOf |
Create New Mapping