Jump to:
loading...| Preferred Name |
kynurenate |
| Synonyms |
4-hydroxyquinoline-2-carboxylate kynurenate |
| Definitions |
A quinolinemonocarboxylate that is the conjugate base of kynurenic acid |
| ID |
http://purl.obolibrary.org/obo/CHEBI_58454 |
| charge |
-1 |
| definition |
A quinolinemonocarboxylate that is the conjugate base of kynurenic acid |
| formula |
C10H6NO3 |
| has role | |
| has_alternative_id |
CHEBI:24991 |
| has_exact_synonym |
4-hydroxyquinoline-2-carboxylate kynurenate |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:58454 |
| in_subset | |
| inchi |
InChI=1S/C10H7NO3/c12-9-5-8(10(13)14)11-7-4-2-1-3-6(7)9/h1-5H,(H,11,12)(H,13,14)/p-1 |
| inchikey |
HCZHHEIFKROPDY-UHFFFAOYSA-M |
| is conjugate base of | |
| label |
kynurenate |
| mass |
188.15950 |
| monoisotopicmass |
188.03532 |
| notation |
CHEBI:58454 |
| prefLabel |
kynurenate |
| smiles |
Oc1cc(nc2ccccc12)C([O-])=O |
| treeView | |
| subClassOf |
Create New Mapping