loading...| Preferred Name |
biopterin |
| Synonyms |
Biopterin 2-amino-6-(1,2-dihydroxypropyl)-4(1H)-pteridinone 2-amino-6-(1,2-dihydroxypropyl)pteridin-4(3H)-one 2-Amino-6-(1,2-dihydroxypropyl)-4(1H)-pteridinone |
| Definitions |
A pterin derivative that consists of pterin bearing amino, oxo and 1,2-dihydroxypropyl substituents at positions 2, 4 and 6 respectively. The parent of the class of biopterins; the L-erythro isomer occurs widely in nature. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_15373 |
| charge |
0 |
| database_cross_reference |
CAS:22150-76-1 PMID:22770225 Wikipedia:Biopterin Reaxys:234314 DrugBank:DB03886 KEGG:C06313 |
| definition |
A pterin derivative that consists of pterin bearing amino, oxo and 1,2-dihydroxypropyl substituents at positions 2, 4 and 6 respectively. The parent of the class of biopterins; the L-erythro isomer occurs widely in nature. |
| formula |
C9H11N5O3 |
| has_alternative_id |
CHEBI:22880 CHEBI:3107 CHEBI:13904 |
| has_exact_synonym |
Biopterin 2-amino-6-(1,2-dihydroxypropyl)pteridin-4(3H)-one |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
2-amino-6-(1,2-dihydroxypropyl)-4(1H)-pteridinone 2-Amino-6-(1,2-dihydroxypropyl)-4(1H)-pteridinone |
| id |
CHEBI:15373 |
| in_subset | |
| inchi |
InChI=1S/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h2-3,6,15-16H,1H3,(H3,10,11,13,14,17) |
| inchikey |
LHQIJBMDNUYRAM-UHFFFAOYSA-N |
| label |
biopterin |
| mass |
237.21554 |
| monoisotopicmass |
237.086 |
| notation |
CHEBI:15373 |
| prefLabel |
biopterin |
| smiles |
CC(O)C(O)c1cnc2nc(N)[nH]c(=O)c2n1 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22881 |