loading...| Preferred Name |
N-oleoylethanolamine phosphate |
| Synonyms |
(Z)-2-oleamidoethyl dihydrogen phosphate 2-[(9Z)-octadec-9-enoylamino]ethyl dihydrogen phosphate NAEPA (Z)-N-[2-(phosphonooxy)ethyl]-9-octadecenamide |
| Definitions |
A N-acylethanolamine phosphate in which the acyl group is specifed as (9Z)-octadec-9-enoyl. It is a lysophosphatidic acid-1 (LPA1) receptor agonist. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_145794 |
| charge |
0 |
| database_cross_reference |
PMID:12069840 PMID:19491366 PMID:12069841 CAS:24435-25-4 |
| definition |
A N-acylethanolamine phosphate in which the acyl group is specifed as (9Z)-octadec-9-enoyl. It is a lysophosphatidic acid-1 (LPA1) receptor agonist. |
| formula |
C20H40NO5P |
| has functional parent | |
| has_exact_synonym |
2-[(9Z)-octadec-9-enoylamino]ethyl dihydrogen phosphate |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
(Z)-2-oleamidoethyl dihydrogen phosphate NAEPA (Z)-N-[2-(phosphonooxy)ethyl]-9-octadecenamide |
| id |
CHEBI:145794 |
| in_subset | |
| inchi |
InChI=1S/C20H40NO5P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(22)21-18-19-26-27(23,24)25/h9-10H,2-8,11-19H2,1H3,(H,21,22)(H2,23,24,25)/b10-9- |
| inchikey |
BCSUWOZFWWBYSX-KTKRTIGZSA-N |
| label |
N-oleoylethanolamine phosphate |
| mass |
405.516 |
| monoisotopicmass |
405.26441 |
| notation |
CHEBI:145794 |
| prefLabel |
N-oleoylethanolamine phosphate |
| smiles |
C(CCCCCCC/C=CCCCCCCCC)(NCCOP(O)(=O)O)=O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||