loading...| Preferred Name |
gabapentin |
| Synonyms |
gabapentine gabapentin [1-(aminomethyl)cyclohexyl]acetic acid 1-(Aminomethyl)cyclohexaneacetic acid gabapentina gabapentinum Neurontin |
| Definitions |
A gamma-amino acid that is cyclohexane substituted at position 1 by aminomethyl and carboxymethyl groups. Used for treatment of neuropathic pain and restless legs syndrome. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_42797 |
| charge |
0 |
| database_cross_reference |
CAS:60142-96-3 PMID:22467888 PMID:22946876 PMID:22352861 PMID:22575516 PMID:22422817 PMID:23018586 HMDB:HMDB0005015 PMID:22612015 PMID:22279347 DrugBank:DB00996 Patent:EP1140793 PMID:22296650 Patent:US2009292138 Beilstein:2359739 KEGG:D00332 VSDB:2975 PMID:22556282 Patent:WO2008060572 PMID:22419014 Wikipedia:Gabapentin PMID:22865488 Patent:US2012046272 LINCS:LSM-5716 PMID:23053645 PMID:22888801 Patent:US2009043126 Patent:WO2005037784 PMID:22934077 PMID:22240859 PMID:22048285 Patent:US2008103334 Drug_Central:1264 PMID:22240839 PMID:22144034 PDBeChem:GBN Patent:US2008269326 PMID:22345405 Reaxys:2359739 Patent:WO2010023694 PMID:22464746 |
| definition |
A gamma-amino acid that is cyclohexane substituted at position 1 by aminomethyl and carboxymethyl groups. Used for treatment of neuropathic pain and restless legs syndrome. |
| formula |
C9H17NO2 |
| has functional parent | |
| has role |
http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_35623 |
| has_alternative_id |
CHEBI:5237 |
| has_exact_synonym |
[1-(aminomethyl)cyclohexyl]acetic acid |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
gabapentine gabapentin 1-(Aminomethyl)cyclohexaneacetic acid gabapentina gabapentinum Neurontin |
| id |
CHEBI:42797 |
| in_subset | |
| inchi |
InChI=1S/C9H17NO2/c10-7-9(6-8(11)12)4-2-1-3-5-9/h1-7,10H2,(H,11,12) |
| inchikey |
UGJMXCAKCUNAIE-UHFFFAOYSA-N |
| label |
gabapentin |
| mass |
171.23680 |
| monoisotopicmass |
171.12593 |
| notation |
CHEBI:42797 |
| prefLabel |
gabapentin |
| smiles |
NCC1(CCCCC1)CC(O)=O |
| treeView | |
| subClassOf |