loading...| Preferred Name |
butamben |
| Synonyms |
Butoform butyl p-aminobenzoate 4-(butoxycarbonyl)aniline butyl 4-aminobenzoate Scuroform p-aminobenzoic acid butyl ester 4-aminobenzoic acid butyl ester butyl aminobenzoate Scuroforme BAB n-butyl p-aminobenzoate Planoform Butesin |
| Definitions |
An amino acid ester resulting from the formal condensation of the carboxy group of 4-aminobenzoic acid with the hydroxy group of butan-1-ol. Its local anaesthetic properties have been used for surface anaesthesia of the skin and mucous membranes, and for relief of pain and itching associated with some anorectal disorders. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_3231 |
| charge |
0 |
| database_cross_reference |
PMID:15923341 Patent:US1440652 PMID:2393134 LINCS:LSM-5413 PMID:15920194 Wikipedia:Butamben Drug_Central:3051 CAS:94-25-7 KEGG:D00730 PMID:16368819 Patent:GB252870 KEGG:C07875 PMID:24486399 PMID:18499609 Reaxys:1211465 PMID:22133806 PMID:9690593 PMID:9009953 PMID:7793660 |
| definition |
An amino acid ester resulting from the formal condensation of the carboxy group of 4-aminobenzoic acid with the hydroxy group of butan-1-ol. Its local anaesthetic properties have been used for surface anaesthesia of the skin and mucous membranes, and for relief of pain and itching associated with some anorectal disorders. |
| formula |
C11H15NO2 |
| has functional parent | |
| has role | |
| has_exact_synonym |
butyl 4-aminobenzoate |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Butoform butyl p-aminobenzoate 4-(butoxycarbonyl)aniline Scuroform p-aminobenzoic acid butyl ester 4-aminobenzoic acid butyl ester butyl aminobenzoate Scuroforme BAB n-butyl p-aminobenzoate Planoform Butesin |
| id |
CHEBI:3231 |
| in_subset | |
| inchi |
InChI=1S/C11H15NO2/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9/h4-7H,2-3,8,12H2,1H3 |
| inchikey |
IUWVALYLNVXWKX-UHFFFAOYSA-N |
| is conjugate base of | |
| label |
butamben |
| mass |
193.24230 |
| monoisotopicmass |
193.11028 |
| notation |
CHEBI:3231 |
| prefLabel |
butamben |
| smiles |
CCCCOC(=O)c1ccc(N)cc1 |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_50994 http://purl.obolibrary.org/obo/CHEBI_48975 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50994 http://purl.obolibrary.org/obo/CHEBI_48975 |