| Preferred Name |
phenylalanine |
| Synonyms |
DL-Phenylalanine fenilalanina 2-amino-3-phenylpropanoic acid Phenylalanine PHE Phenylalanin alpha-Amino-beta-phenylpropionic acid F phenylalanine |
| Definitions |
An aromatic amino acid that is alanine in which one of the methyl hydrogens is substituted by a phenyl group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_28044 |
| charge |
0 |
| database_cross_reference |
PMID:17439666 Gmelin:50836 Wikipedia:Phenylalanine Beilstein:1910407 PMID:22264337 KEGG:C02057 CAS:150-30-1 Reaxys:1910407 |
| definition |
An aromatic amino acid that is alanine in which one of the methyl hydrogens is substituted by a phenyl group. |
| formula |
C9H11NO2 |
| has part | |
| has role | |
| has_alternative_id |
CHEBI:8089 CHEBI:25984 |
| has_exact_synonym |
2-amino-3-phenylpropanoic acid Phenylalanine phenylalanine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
DL-Phenylalanine fenilalanina PHE Phenylalanin alpha-Amino-beta-phenylpropionic acid F |
| id |
CHEBI:28044 |
| in_subset | |
| inchi |
InChI=1S/C9H11NO2/c10-8(9(11)12)6-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12) |
| inchikey |
COLNVLDHVKWLRT-UHFFFAOYSA-N |
| is conjugate acid of | |
| is conjugate base of | |
| label |
phenylalanine |
| mass |
165.18918 |
| monoisotopicmass |
165.07898 |
| notation |
CHEBI:28044 |
| prefLabel |
phenylalanine |
| smiles |
NC(Cc1ccccc1)C(O)=O |
| treeView | |
| subClassOf |