loading...| Preferred Name |
serotonin |
| Synonyms |
thrombocytin 3-(2-Aminoethyl)-1H-indol-5-ol 5-HT Enteramine thrombotonin SEROTONIN Serotonin 5-Hydroxytryptamine serotonine 3-(2-aminoethyl)-1H-indol-5-ol |
| Definitions |
A primary amino compound that is the 5-hydroxy derivative of tryptamine. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_28790 |
| charge |
0 |
| database_cross_reference |
Beilstein:143524 PMID:18593914 LINCS:LSM-6589 PMID:22770225 KEGG:C00780 MetaCyc:SEROTONIN Wikipedia:Serotonin PMID:24136337 Gmelin:1861995 CAS:50-67-9 Reaxys:143524 HMDB:HMDB0000259 PDBeChem:SRO KNApSAcK:C00001429 |
| definition |
A primary amino compound that is the 5-hydroxy derivative of tryptamine. |
| formula |
C10H12N2O |
| has role |
http://purl.obolibrary.org/obo/CHEBI_75771 |
| has_alternative_id |
CHEBI:49894 CHEBI:26652 CHEBI:1420 |
| has_exact_synonym |
SEROTONIN Serotonin 3-(2-aminoethyl)-1H-indol-5-ol |
| has_functional_parent | |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
thrombocytin 3-(2-Aminoethyl)-1H-indol-5-ol 5-HT Enteramine thrombotonin 5-Hydroxytryptamine serotonine |
| id |
CHEBI:28790 |
| in_subset | |
| inchi |
InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2 |
| inchikey |
QZAYGJVTTNCVMB-UHFFFAOYSA-N |
| is_conjugate_base_of | |
| label |
serotonin |
| mass |
176.215 |
| monoisotopicmass |
176.09496 |
| notation |
CHEBI:28790 |
| prefLabel |
serotonin |
| smiles |
C1=CC(=CC=2C(=CNC12)CCN)O |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_84729 http://purl.obolibrary.org/obo/CHEBI_50994 http://purl.obolibrary.org/obo/CHEBI_25375 |