loading...| Preferred Name |
butropium bromide |
| Synonyms |
butropii bromidum bromuro de butropio p-butoxybenzyl hyoscyaminium bromide bromure de butropium Coliopan (1R,3r,5S)-8-[(4-butoxyphenyl)methyl]-3-{[(2S)-3-hydroxy-2-phenylpropanoyl]oxy}-8-methyl-8-azabicyclo[3.2.1]octan-8-ium bromide butropium Br (3-endo)-8-(4-butoxybenzyl)-3-{[(2S)-3-hydroxy-2-phenylpropanoyl]oxy}-8-methyl-8-azoniabicyclo[3.2.1]octane bromide butropium bromide |
| Definitions |
An organic bromide salt of butropium. It is a drug which suppresses spasm of smooth muscles of internal organs, inhibits gastric acid secretion and relieves abdominal pain. It is used in the treatment of spasmodic pains associated with gastritis, gastric ulcers and cholelithiasis. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_31327 |
| charge |
0 |
| database_cross_reference |
PMID:4807878 PMID:4084348 PMID:7431672 PMID:3478945 CAS:29025-14-7 PMID:7182948 KEGG:D01491 Drug_Central:456 PMID:3449985 |
| definition |
An organic bromide salt of butropium. It is a drug which suppresses spasm of smooth muscles of internal organs, inhibits gastric acid secretion and relieves abdominal pain. It is used in the treatment of spasmodic pains associated with gastritis, gastric ulcers and cholelithiasis. |
| formula |
C28H38NO4.Br |
| has part | |
| has role | |
| has_exact_synonym |
(3-endo)-8-(4-butoxybenzyl)-3-{[(2S)-3-hydroxy-2-phenylpropanoyl]oxy}-8-methyl-8-azoniabicyclo[3.2.1]octane bromide |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
butropii bromidum bromuro de butropio p-butoxybenzyl hyoscyaminium bromide bromure de butropium Coliopan (1R,3r,5S)-8-[(4-butoxyphenyl)methyl]-3-{[(2S)-3-hydroxy-2-phenylpropanoyl]oxy}-8-methyl-8-azabicyclo[3.2.1]octan-8-ium bromide butropium Br butropium bromide |
| id |
CHEBI:31327 |
| in_subset | |
| inchi |
InChI=1S/C28H38NO4.BrH/c1-3-4-16-32-25-14-10-21(11-15-25)19-29(2)23-12-13-24(29)18-26(17-23)33-28(31)27(20-30)22-8-6-5-7-9-22;/h5-11,14-15,23-24,26-27,30H,3-4,12-13,16-20H2,1-2H3;1H/q+1;/p-1/t23-,24+,26+,27-,29?;/m1./s1 |
| inchikey |
JABDOYKGZCPHPX-XSCYYCMVSA-M |
| label |
butropium bromide |
| mass |
532.519 |
| monoisotopicmass |
531.19842 |
| notation |
CHEBI:31327 |
| prefLabel |
butropium bromide |
| smiles |
[C@@H]1(C[C@H]2CC[C@@H](C1)[N+]2(C)CC3=CC=C(C=C3)OCCCC)OC([C@@H](C=4C=CC=CC4)CO)=O.[Br-] |
| treeView | |
| subClassOf |