Jump to:
loading...| Preferred Name |
isobutane |
| Synonyms |
E943b isobutane R-600a (CH3)2CH-CH3 2-methylpropane |
| Definitions |
An alkane that is propane substituted by a methyl group at position 2. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_30363 |
| charge |
0 |
| database_cross_reference |
PMID:24464945 PMID:24179026 Reaxys:1730720 Gmelin:1301 Wikipedia:Isobutane Beilstein:1730720 KEGG:D04623 CAS:75-28-5 |
| definition |
An alkane that is propane substituted by a methyl group at position 2. |
| formula |
C4H10 |
| has role | |
| has_exact_synonym |
isobutane 2-methylpropane |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
E943b R-600a (CH3)2CH-CH3 |
| id |
CHEBI:30363 |
| in_subset | |
| inchi |
InChI=1S/C4H10/c1-4(2)3/h4H,1-3H3 |
| inchikey |
NNPPMTNAJDCUHE-UHFFFAOYSA-N |
| label |
isobutane |
| mass |
58.12220 |
| monoisotopicmass |
58.07825 |
| notation |
CHEBI:30363 |
| prefLabel |
isobutane |
| smiles |
CC(C)C |
| treeView | |
| subClassOf |
Create New Mapping