loading...| Preferred Name |
diethylpropion |
| Synonyms |
alpha-benzoyltriethylamine Amfepramone (+-)-diethylpropion alpha-diethylaminopropiophenone Diethylpropion 2-(diethylamino)-1-phenyl-1-propanone anfepramona amfepramonum 2-(diethylamino)propiophenone amfepramone 1-phenyl-2-diethylamino-1-propanone 2-(diethylamino)-1-phenylpropan-1-one |
| Definitions |
An aromatic ketone that is propiophenone in which one of the hydrogens alpha- to the carbonyl is substituted by a diethylamino group. A central stimulant and indirect-acting sympathomimetic, it is an appetite depressant and is used as the hydrochloride as an anoretic in the short term management of obesity. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_4530 |
| charge |
0 |
| database_cross_reference |
KEGG:D07444 Patent:US3001910 PMID:18976683 LINCS:LSM-5038 Wikipedia:Diethylpropion DrugBank:DB00937 CAS:90-84-6 Drug_Central:874 KEGG:C06954 HMDB:HMDB0015072 Beilstein:2804400 Reaxys:2804400 |
| definition |
An aromatic ketone that is propiophenone in which one of the hydrogens alpha- to the carbonyl is substituted by a diethylamino group. A central stimulant and indirect-acting sympathomimetic, it is an appetite depressant and is used as the hydrochloride as an anoretic in the short term management of obesity. |
| formula |
C13H19NO |
| has functional parent | |
| has role | |
| has_exact_synonym |
Diethylpropion 2-(diethylamino)-1-phenylpropan-1-one |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
alpha-benzoyltriethylamine Amfepramone (+-)-diethylpropion alpha-diethylaminopropiophenone 2-(diethylamino)-1-phenyl-1-propanone anfepramona amfepramonum 2-(diethylamino)propiophenone amfepramone 1-phenyl-2-diethylamino-1-propanone |
| id |
CHEBI:4530 |
| in_subset | |
| inchi |
InChI=1S/C13H19NO/c1-4-14(5-2)11(3)13(15)12-9-7-6-8-10-12/h6-11H,4-5H2,1-3H3 |
| inchikey |
XXEPPPIWZFICOJ-UHFFFAOYSA-N |
| label |
diethylpropion |
| mass |
205.29610 |
| monoisotopicmass |
205.14666 |
| notation |
CHEBI:4530 |
| prefLabel |
diethylpropion |
| smiles |
CCN(CC)C(C)C(=O)c1ccccc1 |
| treeView | |
| subClassOf |