loading...| Preferred Name |
tavaborole |
| Synonyms |
5-fluoro-2,1-benzoxaborol-1(3H)-ol AN-2690 AN 2690 5-Fluoro-1,3-dihydro-1-hydroxy-2,1-benzoxaborole AN2690 |
| Definitions |
A member of the class of benzoxaboroles that is 1,3-dihydro-1-hydroxy-2,1-benzoxaborole substituted at position 5 by a fluoro group. A topical antifungal agent used for the treatment of onychomycosis (fungal infection of the toenails and fingernails). |
| ID |
http://purl.obolibrary.org/obo/CHEBI_77942 |
| charge |
0 |
| database_cross_reference |
PMID:19426743 PMID:23625818 CAS:174671-46-6 PMID:24578778 KEGG:D10169 PMID:20557293 PMID:24070182 Reaxys:10657796 PMID:22533461 PMID:17588934 PMID:17621679 PMID:17668368 PMID:16854048 Drug_Central:4877 PMID:24156162 PMID:19940155 PMID:21523085 PMID:21856301 |
| definition |
A member of the class of benzoxaboroles that is 1,3-dihydro-1-hydroxy-2,1-benzoxaborole substituted at position 5 by a fluoro group. A topical antifungal agent used for the treatment of onychomycosis (fungal infection of the toenails and fingernails). |
| formula |
C7H6BFO2 |
| has role |
http://purl.obolibrary.org/obo/CHEBI_48001 |
| has_exact_synonym |
5-fluoro-2,1-benzoxaborol-1(3H)-ol |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
AN-2690 AN 2690 5-Fluoro-1,3-dihydro-1-hydroxy-2,1-benzoxaborole AN2690 |
| id |
CHEBI:77942 |
| in_subset | |
| inchi |
InChI=1S/C7H6BFO2/c9-6-1-2-7-5(3-6)4-11-8(7)10/h1-3,10H,4H2 |
| inchikey |
LFQDNHWZDQTITF-UHFFFAOYSA-N |
| label |
tavaborole |
| mass |
151.93100 |
| monoisotopicmass |
152.04449 |
| notation |
CHEBI:77942 |
| prefLabel |
tavaborole |
| smiles |
OB1OCc2cc(F)ccc12 |
| treeView | |
| subClassOf |