loading...| Preferred Name |
7-aminomethyl-7-deazaguanine |
| Synonyms |
7-Aminomethyl-7-carbaguanine 7-DEAZA-7-AMINOMETHYL-GUANINE 7-Aminomethyl-7-deazaguanine 2-amino-5-(aminomethyl)-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one |
| Definitions |
A pyrrolopyrimidine that is 7-deazaguanine bearing an aminomethyl substituent at the 7 position. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_45126 |
| charge |
0 |
| database_cross_reference |
PDBeChem:PRF DrugBank:DB03304 KEGG:C16675 Beilstein:521890 |
| definition |
A pyrrolopyrimidine that is 7-deazaguanine bearing an aminomethyl substituent at the 7 position. |
| formula |
C7H9N5O |
| has_exact_synonym |
7-Aminomethyl-7-deazaguanine 2-amino-5-(aminomethyl)-3,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
7-Aminomethyl-7-carbaguanine 7-DEAZA-7-AMINOMETHYL-GUANINE |
| id |
CHEBI:45126 |
| in_subset | |
| inchi |
InChI=1S/C7H9N5O/c8-1-3-2-10-5-4(3)6(13)12-7(9)11-5/h2H,1,8H2,(H4,9,10,11,12,13) |
| inchikey |
MEYMBLGOKYDGLZ-UHFFFAOYSA-N |
| is conjugate base of | |
| label |
7-aminomethyl-7-deazaguanine |
| mass |
179.17930 |
| monoisotopicmass |
179.08071 |
| notation |
CHEBI:45126 |
| prefLabel |
7-aminomethyl-7-deazaguanine |
| smiles |
NCc1c[nH]c2nc(N)[nH]c(=O)c12 |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C096876 | Medical Subject Headings / 医学主题词表 | LOOM |