loading...| Preferred Name |
diflubenzuron |
| Synonyms |
N-[(4-chlorophenyl)carbamoyl]-2,6-difluorobenzamide 1-(4-chlorophenyl)-3-(2,6-difluorobenzoyl)urea N-(4-Chlorophenylcarbamoyl)-2,6-difluorobenzamide difluron 1-(p-chlorophenyl)-3-(2,6-difluorobenzoyl)urea Diflubenzuron N-{[(4-chlorophenyl)amino]carbonyl}-2,6-difluorobenzamide |
| Definitions |
A benzoylurea insecticide that is urea in which a hydrogen attached to one of the nitrogens is replaced by a 4-chlorophenyl group, and a hydrogen attached to the other nitrogen is replaced bgy a 2,6-difluorobenzoyl group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_34703 |
| charge |
0 |
| database_cross_reference |
Wikipedia:Diflubenzuron KEGG:D07829 PMID:22782793 PMID:8510122 Beilstein:2162461 CAS:35367-38-5 PPDB:234 PMID:20954045 KEGG:C14427 PMID:19835689 HMDB:HMDB0031778 |
| definition |
A benzoylurea insecticide that is urea in which a hydrogen attached to one of the nitrogens is replaced by a 4-chlorophenyl group, and a hydrogen attached to the other nitrogen is replaced bgy a 2,6-difluorobenzoyl group. |
| formula |
C14H9ClF2N2O2 |
| has functional parent | |
| has role | |
| has_exact_synonym |
N-[(4-chlorophenyl)carbamoyl]-2,6-difluorobenzamide Diflubenzuron |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
1-(4-chlorophenyl)-3-(2,6-difluorobenzoyl)urea N-(4-Chlorophenylcarbamoyl)-2,6-difluorobenzamide difluron 1-(p-chlorophenyl)-3-(2,6-difluorobenzoyl)urea N-{[(4-chlorophenyl)amino]carbonyl}-2,6-difluorobenzamide |
| id |
CHEBI:34703 |
| in_subset | |
| inchi |
InChI=1S/C14H9ClF2N2O2/c15-8-4-6-9(7-5-8)18-14(21)19-13(20)12-10(16)2-1-3-11(12)17/h1-7H,(H2,18,19,20,21) |
| inchikey |
QQQYTWIFVNKMRW-UHFFFAOYSA-N |
| label |
diflubenzuron |
| mass |
310.68305 |
| monoisotopicmass |
310.03206 |
| notation |
CHEBI:34703 |
| prefLabel |
diflubenzuron |
| smiles |
Fc1cccc(F)c1C(=O)NC(=O)Nc1ccc(Cl)cc1 |
| treeView | |
| subClassOf |