loading...| Preferred Name |
chlorquinaldol |
| Synonyms |
clorquinaldol 5,7-dichloro-2-methyl-8-hydroxyquinoline 5,7-dichloro-8-hydroxyquinaldine 5,7-dichloro-8-hydroxy-2-methylquinoline 5,7-dichloro-2-methylquinolin-8-ol 5,7-dichloro-8-quinaldinol chlorquinaldol 5,7-dichloro-2-methyl-8-quinolinol chlorquinaldolum 2-methyl-5,7-dichloro-8-hydroxyquinoline |
| Definitions |
A monohydroxyquinoline that is quinolin-8-ol which is substituted by a methyl group at position 2 and by chlorine at positions 5 and 7. An antifungal and antibacterial, it was formerly used for topical treatment of skin conditions and vaginal infections. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_74500 |
| charge |
0 |
| database_cross_reference |
Wikipedia:Chlorquinaldol Reaxys:156683 Drug_Central:3095 PMID:13307049 KEGG:D07208 PMID:6228382 PMID:478062 Patent:US2411670 CAS:72-80-0 |
| definition |
A monohydroxyquinoline that is quinolin-8-ol which is substituted by a methyl group at position 2 and by chlorine at positions 5 and 7. An antifungal and antibacterial, it was formerly used for topical treatment of skin conditions and vaginal infections. |
| formula |
C10H7Cl2NO |
| has role |
http://purl.obolibrary.org/obo/CHEBI_36047 |
| has_exact_synonym |
5,7-dichloro-2-methylquinolin-8-ol |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
clorquinaldol 5,7-dichloro-2-methyl-8-hydroxyquinoline 5,7-dichloro-8-hydroxyquinaldine 5,7-dichloro-8-hydroxy-2-methylquinoline 5,7-dichloro-8-quinaldinol chlorquinaldol 5,7-dichloro-2-methyl-8-quinolinol chlorquinaldolum 2-methyl-5,7-dichloro-8-hydroxyquinoline |
| id |
CHEBI:74500 |
| in_subset | |
| inchi |
InChI=1S/C10H7Cl2NO/c1-5-2-3-6-7(11)4-8(12)10(14)9(6)13-5/h2-4,14H,1H3 |
| inchikey |
GPTXWRGISTZRIO-UHFFFAOYSA-N |
| label |
chlorquinaldol |
| mass |
228.07500 |
| monoisotopicmass |
226.99047 |
| notation |
CHEBI:74500 |
| prefLabel |
chlorquinaldol |
| smiles |
Cc1ccc2c(Cl)cc(Cl)c(O)c2n1 |
| treeView | |
| subClassOf |