loading...| Preferred Name |
penciclovir |
| Synonyms |
2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-1,9-dihydro-6H-purin-6-one 9-(4-hydroxy-3-hydroxymethylbut-1-yl)-guanine penciclovirum 9-(4-hydroxy-3-(hydroxymethyl)butyl)guanine 9-[4-hydroxy-3-(hydroxymethyl)but-1-yl]guanine 9-[2-hydroxy-1-(hydroxymethyl)-ethoxymethyl]guanine PCV penciclovir PE2 |
| Definitions |
A member of the class of 2-aminopurines that is guanine in which the hydrogen at position 9 is substituted by a 4-hydroxy-3-(hydroxymethyl)but-1-yl group. An antiviral drug, it is administered topically for treatment of herpes labialis. A prodrug, famciclovir, is used for oral administration. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_7956 |
| charge |
0 |
| database_cross_reference |
DrugBank:DB00299 HMDB:HMDB0014444 KEGG:C07417 Wikipedia:Penciclovir KEGG:D05407 Reaxys:4501039 PDBeChem:PE2 Patent:US5075445 LINCS:LSM-5587 PMID:3040998 Drug_Central:2079 CAS:39809-25-1 |
| definition |
A member of the class of 2-aminopurines that is guanine in which the hydrogen at position 9 is substituted by a 4-hydroxy-3-(hydroxymethyl)but-1-yl group. An antiviral drug, it is administered topically for treatment of herpes labialis. A prodrug, famciclovir, is used for oral administration. |
| formula |
C10H15N5O3 |
| has functional parent | |
| has role | |
| has_alternative_id |
CHEBI:44870 |
| has_exact_synonym |
2-amino-9-[4-hydroxy-3-(hydroxymethyl)butyl]-1,9-dihydro-6H-purin-6-one |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
9-(4-hydroxy-3-hydroxymethylbut-1-yl)-guanine penciclovirum 9-(4-hydroxy-3-(hydroxymethyl)butyl)guanine 9-[4-hydroxy-3-(hydroxymethyl)but-1-yl]guanine 9-[2-hydroxy-1-(hydroxymethyl)-ethoxymethyl]guanine PCV penciclovir PE2 |
| id |
CHEBI:7956 |
| in_subset | |
| inchi |
InChI=1S/C10H15N5O3/c11-10-13-8-7(9(18)14-10)12-5-15(8)2-1-6(3-16)4-17/h5-6,16-17H,1-4H2,(H3,11,13,14,18) |
| inchikey |
JNTOCHDNEULJHD-UHFFFAOYSA-N |
| label |
penciclovir |
| mass |
253.25780 |
| monoisotopicmass |
253.11749 |
| notation |
CHEBI:7956 |
| prefLabel |
penciclovir |
| smiles |
Nc1nc2n(CCC(CO)CO)cnc2c(=O)[nH]1 |
| treeView | |
| subClassOf |