Jump to:
loading...| Preferred Name |
serotonin(1+) |
| Synonyms |
serotonin 2-(5-hydroxy-1H-indol-3-yl)ethanaminium serotonin cation |
| Definitions |
An ammonium ion that is the conjugate acid of serotonin; major species at pH 7.3. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_350546 |
| charge |
+1 |
| definition |
An ammonium ion that is the conjugate acid of serotonin; major species at pH 7.3. |
| formula |
C10H13N2O |
| has role | |
| has_exact_synonym |
2-(5-hydroxy-1H-indol-3-yl)ethanaminium |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
serotonin serotonin cation |
| id |
CHEBI:350546 |
| in_subset | |
| inchi |
InChI=1S/C10H12N2O/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10/h1-2,5-6,12-13H,3-4,11H2/p+1 |
| inchikey |
QZAYGJVTTNCVMB-UHFFFAOYSA-O |
| is conjugate acid of | |
| label |
serotonin(1+) |
| mass |
177.22250 |
| monoisotopicmass |
177.10224 |
| notation |
CHEBI:350546 |
| prefLabel |
serotonin(1+) |
| smiles |
[NH3+]CCc1c[nH]c2ccc(O)cc12 |
| treeView | |
| subClassOf |
Create New Mapping