| Preferred Name |
leucine |
| Synonyms |
(+-)-Leucine 2-amino-4-methylpentanoic acid Leu Leuzin (RS)-Leucine DL-Leucine Leucin leucine L Hleu |
| Definitions |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isobutyl group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_25017 |
| charge |
0 |
| database_cross_reference |
Gmelin:50203 KEGG:C16439 PMID:17439666 LIPID_MAPS_instance:LMFA01100048 Beilstein:636005 CAS:328-39-2 Wikipedia:Leucine Reaxys:636005 |
| formula |
C6H13NO2 |
| has exact synonym |
leucine |
| has role | |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
(+-)-Leucine 2-amino-4-methylpentanoic acid Leu Leuzin (RS)-Leucine DL-Leucine Leucin L Hleu |
| id |
CHEBI:25017 |
| imported from | |
| in subset | |
| inchi |
InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9) |
| inchikey |
ROHFNLRQFUQHCH-UHFFFAOYSA-N |
| is conjugate acid of | |
| is conjugate base of | |
| label |
leucine |
| mass |
131.17296 |
| monoisotopicmass |
131.09463 |
| notation |
CHEBI:25017 |
| prefLabel |
leucine |
| smiles |
CC(C)CC(N)C(O)=O |
| textual definition |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isobutyl group. |
| subClassOf | |
| has_part |