Jump to:
loading...| Preferred Name |
lysine |
| Synonyms |
alpha,epsilon-diaminocaproic acid 2,6-diaminohexanoic acid K lysine LYS Lysin |
| Definitions |
A diamino acid that is caproic (hexanoic) acid bearing two amino substituents at positions 2 and 6. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_25094 |
| charge |
0 |
| database_cross_reference |
CAS:70-54-2 Wikipedia:Lysine PMID:17439666 Beilstein:1616991 KEGG:C16440 Reaxys:1616991 PMID:22264337 Gmelin:279284 |
| formula |
C6H14N2O2 |
| has exact synonym |
2,6-diaminohexanoic acid lysine |
| has functional parent | |
| has role | |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
alpha,epsilon-diaminocaproic acid K LYS Lysin |
| id |
CHEBI:25094 |
| imported from | |
| in subset | |
| inchi |
InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10) |
| inchikey |
KDXKERNSBIXSRK-UHFFFAOYSA-N |
| is conjugate acid of | |
| is conjugate base of | |
| label |
lysine |
| mass |
146.18764 |
| monoisotopicmass |
146.10553 |
| notation |
CHEBI:25094 |
| prefLabel |
lysine |
| smiles |
NCCCCC(N)C(O)=O |
| textual definition |
A diamino acid that is caproic (hexanoic) acid bearing two amino substituents at positions 2 and 6. |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26167 |
| has_part |
Create New Mapping