loading...| Preferred Name |
nandrolone |
| Synonyms |
Nandrolone (17beta)-17-hydroxyestr-4-en-3-one 19-Nortestosterone 17beta-hydroxyestr-4-en-3-one 19-Norandrostenolone 17beta-hydroxy-4-estren-3-one 4-estren-17beta-ol-3-one 17beta-hydroxy-19-nor-4-androsten-3-one |
| Definitions |
A 3-oxo Delta(4)-steroid that is estr-4-en-3-one substituted by a beta-hydroxy group at position 17. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_7466 |
| charge |
0 |
| database_cross_reference |
VSDB:1861 PMID:11888015 KEGG:D08250 Drug_Central:1879 DrugBank:DB00984 Wikipedia:Nandrolone Beilstein:4690380 CAS:434-22-0 HMDB:HMDB0002725 PMID:24405322 KEGG:C07254 PMID:19055689 PMID:20020363 Reaxys:2055849 Beilstein:2055849 Gmelin:1228044 |
| definition |
A 3-oxo Delta(4)-steroid that is estr-4-en-3-one substituted by a beta-hydroxy group at position 17. |
| formula |
C18H26O2 |
| has parent hydride | |
| has role | |
| has_exact_synonym |
Nandrolone 17beta-hydroxyestr-4-en-3-one |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
(17beta)-17-hydroxyestr-4-en-3-one 19-Nortestosterone 17beta-hydroxyestr-4-en-3-one 19-Norandrostenolone 17beta-hydroxy-4-estren-3-one 4-estren-17beta-ol-3-one 17beta-hydroxy-19-nor-4-androsten-3-one |
| id |
CHEBI:7466 |
| in_subset | |
| inchi |
InChI=1S/C18H26O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,13-17,20H,2-9H2,1H3/t13-,14+,15+,16-,17-,18-/m0/s1 |
| inchikey |
NPAGDVCDWIYMMC-IZPLOLCNSA-N |
| label |
nandrolone |
| mass |
274.39780 |
| monoisotopicmass |
274.19328 |
| notation |
CHEBI:7466 |
| prefLabel |
nandrolone |
| smiles |
[H][C@]12CCC(=O)C=C1CC[C@]1([H])[C@]2([H])CC[C@]2(C)[C@@H](O)CC[C@@]12[H] |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_35343 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_35343 |