| Preferred Name |
ATP(4-) |
| Synonyms |
adenosine 5'-triphosphate(4-) atp ATP |
| Definitions |
A nucleoside triphosphate(4-) obtained by global deprotonation of the triphosphate OH groups of ATP; major species present at pH 7.3. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_30616 |
| charge |
-4 |
| database_cross_reference |
Beilstein:3581767 Gmelin:342798 |
| definition |
A nucleoside triphosphate(4-) obtained by global deprotonation of the triphosphate OH groups of ATP; major species present at pH 7.3. |
| formula |
C10H12N5O13P3 |
| has role |
http://purl.obolibrary.org/obo/CHEBI_23357 |
| has_exact_synonym |
adenosine 5'-triphosphate(4-) |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
atp ATP |
| id |
CHEBI:30616 |
| in_subset | |
| inchi |
InChI=1S/C10H16N5O13P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(17)6(16)4(26-10)1-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-4,6-7,10,16-17H,1H2,(H,21,22)(H,23,24)(H2,11,12,13)(H2,18,19,20)/p-4/t4-,6-,7-,10-/m1/s1 |
| inchikey |
ZKHQWZAMYRWXGA-KQYNXXCUSA-J |
| is conjugate base of | |
| label |
ATP(4-) |
| mass |
503.14946 |
| monoisotopicmass |
502.96664 |
| notation |
CHEBI:30616 |
| prefLabel |
ATP(4-) |
| smiles |
Nc1ncnc2n(cnc12)[C@@H]1O[C@H](COP([O-])(=O)OP([O-])(=O)OP([O-])([O-])=O)[C@@H](O)[C@H]1O |
| treeView | |
| subClassOf |