Jump to:
loading...| Preferred Name |
4-nitrobenzaldehyde |
| Synonyms |
4-nitrobenzaldehyde p-nitrobenzaldehyde |
| Definitions |
A C-nitro compound that is benzaldehyde substituted at the para-position with a nitro group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_66926 |
| charge |
0 |
| database_cross_reference |
PMID:19360727 PMID:22318956 PMID:19066862 MetaCyc:CPD-703 PMID:1650428 Wikipedia:4-Nitrobenzaldehyde Reaxys:386796 PMID:22803669 CAS:555-16-8 |
| definition |
A C-nitro compound that is benzaldehyde substituted at the para-position with a nitro group. |
| formula |
C7H5NO3 |
| has_exact_synonym |
4-nitrobenzaldehyde |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
p-nitrobenzaldehyde |
| id |
CHEBI:66926 |
| in_subset | |
| inchi |
InChI=1S/C7H5NO3/c9-5-6-1-3-7(4-2-6)8(10)11/h1-5H |
| inchikey |
BXRFQSNOROATLV-UHFFFAOYSA-N |
| label |
4-nitrobenzaldehyde |
| mass |
151.11950 |
| monoisotopicmass |
151.02694 |
| notation |
CHEBI:66926 |
| prefLabel |
4-nitrobenzaldehyde |
| smiles |
[O-][N+](=O)c1ccc(C=O)cc1 |
| treeView | |
| subClassOf |
Create New Mapping
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C029915 | Medical Subject Headings / 医学主题词表 | LOOM |