loading...| Preferred Name |
sumatriptan |
| Synonyms |
sumatriptanum Imitrex Sumax 1-[3-(2-dimethylaminoethyl)-1H-indol-5-yl]-N-methyl-methanesulfonamide Sumatran 3-[2-(dimethylamino)ethyl]-N-methylindole-5-methanesulfonamide (3-[2-(dimethylamino)ethyl]-1H-indol-5-yl)-N-methylmethanesulfonamide Imigran 1-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}-N-methylmethanesulfonamide 3-(2-(dimethylamino)ethyl)-N-methyl-1H-indole-5-methanesulfonamide sumatriptan |
| Definitions |
A sulfonamide that consists of N,N-dimethyltryptamine bearing an additional (N-methylsulfamoyl)methyl substituent at position 5. Selective agonist for a vascular 5-HT1 receptor subtype (probably a member of the 5-HT1D family). Used (in the form of its succinate salt) for the acute treatment of migraine with or without aura in adults. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_10650 |
| charge |
0 |
| database_cross_reference |
PMID:22336867 PMID:22106962 PMID:22435741 PMID:22336868 PMID:19825906 Wikipedia:Sumatriptan HMDB:HMDB0005037 PMID:22302025 KEGG:D00451 LINCS:LSM-5618 Reaxys:5346011 Beilstein:5346011 PMID:16142613 CAS:103628-46-2 PMID:22272067 PMID:18442019 PMID:22150557 PMID:17557349 PMID:22336849 PMID:12172708 PMID:15652399 KEGG:C07319 PMID:16120224 PMID:12856385 DrugBank:DB00669 Drug_Central:2543 PMID:12917936 PMID:19619527 PMID:11045888 PMID:11401410 |
| definition |
A sulfonamide that consists of N,N-dimethyltryptamine bearing an additional (N-methylsulfamoyl)methyl substituent at position 5. Selective agonist for a vascular 5-HT1 receptor subtype (probably a member of the 5-HT1D family). Used (in the form of its succinate salt) for the acute treatment of migraine with or without aura in adults. |
| formula |
C14H21N3O2S |
| has functional parent | |
| has role | |
| has_exact_synonym |
1-{3-[2-(dimethylamino)ethyl]-1H-indol-5-yl}-N-methylmethanesulfonamide |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
sumatriptanum Imitrex Sumax 1-[3-(2-dimethylaminoethyl)-1H-indol-5-yl]-N-methyl-methanesulfonamide Sumatran 3-[2-(dimethylamino)ethyl]-N-methylindole-5-methanesulfonamide (3-[2-(dimethylamino)ethyl]-1H-indol-5-yl)-N-methylmethanesulfonamide Imigran 3-(2-(dimethylamino)ethyl)-N-methyl-1H-indole-5-methanesulfonamide sumatriptan |
| id |
CHEBI:10650 |
| in_subset | |
| inchi |
InChI=1S/C14H21N3O2S/c1-15-20(18,19)10-11-4-5-14-13(8-11)12(9-16-14)6-7-17(2)3/h4-5,8-9,15-16H,6-7,10H2,1-3H3 |
| inchikey |
KQKPFRSPSRPDEB-UHFFFAOYSA-N |
| is conjugate acid of | |
| label |
sumatriptan |
| mass |
295.40000 |
| monoisotopicmass |
295.13545 |
| notation |
CHEBI:10650 |
| prefLabel |
sumatriptan |
| smiles |
CNS(=O)(=O)Cc1ccc2[nH]cc(CCN(C)C)c2c1 |
| treeView | |
| subClassOf |