loading...| Preferred Name |
trimethylamine |
| Synonyms |
N(CH3)3 N,N,N-trimethylamine TMA N,N-dimethylmethanamine Trimethylamin (CH3)3N N,N-Dimethylmethanamine tridimethylaminomethane NMe3 Trimethylamine |
| Definitions |
A tertiary amine that is ammonia in which each hydrogen atom is substituted by an methyl group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_18139 |
| charge |
0 |
| database_cross_reference |
KNApSAcK:C00001433 Reaxys:956566 PMID:1801314 Beilstein:956566 KEGG:C00565 PMID:15304308 PMID:17190852 MetaCyc:TRIMETHYLAMINE PMID:24591617 CAS:75-50-3 Wikipedia:Trimethylamine PMID:5161463 PMID:14047118 PMID:2501587 HMDB:HMDB0000906 PMID:15752091 Gmelin:1309 PDBeChem:KEN |
| definition |
A tertiary amine that is ammonia in which each hydrogen atom is substituted by an methyl group. |
| formula |
C3H9N |
| has_alternative_id |
CHEBI:9732 CHEBI:27125 CHEBI:27127 CHEBI:15261 |
| has_exact_synonym |
N,N-dimethylmethanamine Trimethylamine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
N(CH3)3 N,N,N-trimethylamine TMA Trimethylamin (CH3)3N N,N-Dimethylmethanamine tridimethylaminomethane NMe3 |
| id |
CHEBI:18139 |
| in_subset | |
| inchi |
InChI=1S/C3H9N/c1-4(2)3/h1-3H3 |
| inchikey |
GETQZCLCWQTVFV-UHFFFAOYSA-N |
| label |
trimethylamine |
| mass |
59.11030 |
| monoisotopicmass |
59.073 |
| notation |
CHEBI:18139 |
| prefixIRI |
CHEBI:18139 |
| prefLabel |
trimethylamine |
| smiles |
CN(C)C |
| subClassOf |
http://purl.obolibrary.org/obo/GOCHE_76971 http://purl.obolibrary.org/obo/CHEBI_32876 |