Jump to:
loading...| Preferred Name |
cholanic acid |
| Synonyms |
cholan-24-oic acid |
| Definitions |
A steroid acid that consists of cholane having a carboxy group in place of the methyl group at position 24. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_36237 |
| charge |
0 |
| database_cross_reference |
Patent:JP2008069152 Reaxys:13246008 CAS:25312-65-6 |
| definition |
A steroid acid that consists of cholane having a carboxy group in place of the methyl group at position 24. |
| formula |
C24H40O2 |
| has_exact_synonym |
cholan-24-oic acid |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:36237 |
| in_subset | |
| inchi |
InChI=1S/C24H40O2/c1-16(7-12-22(25)26)19-10-11-20-18-9-8-17-6-4-5-14-23(17,2)21(18)13-15-24(19,20)3/h16-21H,4-15H2,1-3H3,(H,25,26)/t16-,17?,18+,19-,20+,21+,23+,24-/m1/s1 |
| inchikey |
RPKLZQLYODPWTM-KBMWBBLPSA-N |
| label |
cholanic acid |
| mass |
360.57320 |
| monoisotopicmass |
360.303 |
| notation |
CHEBI:36237 |
| prefLabel |
cholanic acid |
| smiles |
[H][C@@]1(CC[C@@]2([H])[C@]3([H])CCC4CCCC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCC(O)=O |
| subClassOf |
Create New Mapping