loading...| Preferred Name |
promethazine |
| Synonyms |
(2-dimethylamino-2-methyl)ethyl-N-dibenzoparathiazine promethazine 10-(2-Dimethylaminopropyl)phenothiazine proazamine promethazinum N,N,alpha-trimethyl-10H-phenothiazine-10-ethanamine N-(2'-dimethylamino-2'-methyl)ethylphenothiazine 10-[2-(dimethylamino)propyl]phenothiazine N,N-dimethyl-1-(10H-phenothiazin-10-yl)propan-2-amine Promethazine prometazina |
| Definitions |
A tertiary amine that is a substituted phenothiazine in which the ring nitrogen at position 10 is attached to C-3 of an N,N-dimethylpropan-2-amine moiety. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_8461 |
| charge |
0 |
| database_cross_reference |
Reaxys:88554 HMDB:HMDB0015202 DrugBank:DB01069 KEGG:D00494 Beilstein:88554 Patent:US2530451 Patent:US2607773 KEGG:C07404 Drug_Central:2286 Wikipedia:Promethazine CAS:60-87-7 LINCS:LSM-4440 Gmelin:337077 |
| definition |
A tertiary amine that is a substituted phenothiazine in which the ring nitrogen at position 10 is attached to C-3 of an N,N-dimethylpropan-2-amine moiety. |
| formula |
C17H20N2S |
| has role |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_36333 http://purl.obolibrary.org/obo/CHEBI_50919 http://purl.obolibrary.org/obo/CHEBI_50857 http://purl.obolibrary.org/obo/CHEBI_59683 |
| has_exact_synonym |
N,N-dimethyl-1-(10H-phenothiazin-10-yl)propan-2-amine Promethazine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
(2-dimethylamino-2-methyl)ethyl-N-dibenzoparathiazine promethazine 10-(2-Dimethylaminopropyl)phenothiazine proazamine promethazinum N,N,alpha-trimethyl-10H-phenothiazine-10-ethanamine N-(2'-dimethylamino-2'-methyl)ethylphenothiazine 10-[2-(dimethylamino)propyl]phenothiazine prometazina |
| id |
CHEBI:8461 |
| in_subset | |
| inchi |
InChI=1S/C17H20N2S/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)20-17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3 |
| inchikey |
PWWVAXIEGOYWEE-UHFFFAOYSA-N |
| is conjugate base of | |
| label |
promethazine |
| mass |
284.42018 |
| monoisotopicmass |
284.13472 |
| notation |
CHEBI:8461 |
| prefLabel |
promethazine |
| smiles |
CC(CN1c2ccccc2Sc2ccccc12)N(C)C |
| treeView | |
| subClassOf |