loading...| Preferred Name |
8-desmethylsideroxylin |
| Synonyms |
5,4'-dihydroxy-7-methoxy-6-methylflavone 5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-6-methyl-4H-chromen-4-one |
| Definitions |
A monomethoxyflavone that is sideroxylin in which the methyl group at position 8 is replaced by a hydrogen. It has been found in Hydrastis canadensis and Eucalyptus species. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_69917 |
| charge |
0 |
| database_cross_reference |
PMID:21661731 Reaxys:6152386 |
| definition |
A monomethoxyflavone that is sideroxylin in which the methyl group at position 8 is replaced by a hydrogen. It has been found in Hydrastis canadensis and Eucalyptus species. |
| formula |
C17H14O5 |
| has functional parent | |
| has role | |
| has_exact_synonym |
5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-6-methyl-4H-chromen-4-one |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
5,4'-dihydroxy-7-methoxy-6-methylflavone |
| id |
CHEBI:69917 |
| in_subset | |
| inchi |
InChI=1S/C17H14O5/c1-9-13(21-2)8-15-16(17(9)20)12(19)7-14(22-15)10-3-5-11(18)6-4-10/h3-8,18,20H,1-2H3 |
| inchikey |
VQCXCCMCKDSXMQ-UHFFFAOYSA-N |
| label |
8-desmethylsideroxylin |
| mass |
298.29010 |
| monoisotopicmass |
298.08412 |
| notation |
CHEBI:69917 |
| prefLabel |
8-desmethylsideroxylin |
| smiles |
COc1cc2oc(cc(=O)c2c(O)c1C)-c1ccc(O)cc1 |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.bioontology.org/ontology/MESH/C561551 | Medical Subject Headings / 医学主题词表 | LOOM |