loading...| Preferred Name |
morphine |
| Synonyms |
Morphin Morphia morphinum morphium (-)-morphine Morphine 17-methyl-7,8-didehydro-4,5alpha-epoxymorphinan-3,6alpha-diol (5R,6S,9R,13S,14R)-4,5-epoxy-N-methyl-7-morphinen-3,6-diol morfina (5alpha,6alpha)-didehydro-4,5-epoxy-17-methylmorphinan-3,6-diol (7R,7AS,12BS)-3-METHYL-2,3,4,4A,7,7A-HEXAHYDRO-1H-4,12-METHANO[1]BENZOFURO[3,2-E]ISOQUINOLINE-7,9-DIOL (5alpha,6alpha)-17-methyl-7,8-didehydro-4,5-epoxymorphinan-3,6-diol |
| Definitions |
A morphinane alkaloid that is a highly potent opiate analgesic psychoactive drug. Morphine acts directly on the central nervous system (CNS) to relieve pain but has a high potential for addiction, with tolerance and both physical and psychological dependence developing rapidly. Morphine is the most abundant opiate found in Papaver somniferum (the opium poppy). |
| ID |
http://purl.obolibrary.org/obo/CHEBI_17303 |
| charge |
0 |
| database_cross_reference |
PMID:12593758 PMID:24096538 PMID:23927484 PDB:1Q0Y PMID:29368335 DrugBank:DB00295 PMID:19371311 PMID:27815868 PMID:20071451 PMID:15019787 PMID:17667569 KEGG:D08233 Reaxys:93704 Drug_Central:1845 Wikipedia:Morphine PMID:23555556 Beilstein:93704 PMID:23325235 VSDB:2982 PMID:21061062 PMID:27866460 PMID:9231550 PMID:24306419 PDBeChem:MOI PMID:23988259 PMID:23292329 KEGG:C01516 PMID:17171884 PMID:27735107 MetaCyc:MORPHINE KNApSAcK:C00001889 CAS:57-27-2 |
| definition |
A morphinane alkaloid that is a highly potent opiate analgesic psychoactive drug. Morphine acts directly on the central nervous system (CNS) to relieve pain but has a high potential for addiction, with tolerance and both physical and psychological dependence developing rapidly. Morphine is the most abundant opiate found in Papaver somniferum (the opium poppy). |
| formula |
C17H19NO3 |
| has parent hydride | |
| has role |
http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_38867 http://purl.obolibrary.org/obo/CHEBI_88188 http://purl.obolibrary.org/obo/CHEBI_55322 http://purl.obolibrary.org/obo/CHEBI_78298 http://purl.obolibrary.org/obo/CHEBI_35620 http://purl.obolibrary.org/obo/CHEBI_35482 |
| has_alternative_id |
CHEBI:14622 CHEBI:44202 CHEBI:25419 CHEBI:7001 |
| has_exact_synonym |
Morphine 17-methyl-7,8-didehydro-4,5alpha-epoxymorphinan-3,6alpha-diol |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Morphin Morphia morphinum morphium (-)-morphine (5R,6S,9R,13S,14R)-4,5-epoxy-N-methyl-7-morphinen-3,6-diol morfina (5alpha,6alpha)-didehydro-4,5-epoxy-17-methylmorphinan-3,6-diol (7R,7AS,12BS)-3-METHYL-2,3,4,4A,7,7A-HEXAHYDRO-1H-4,12-METHANO[1]BENZOFURO[3,2-E]ISOQUINOLINE-7,9-DIOL (5alpha,6alpha)-17-methyl-7,8-didehydro-4,5-epoxymorphinan-3,6-diol |
| id |
CHEBI:17303 |
| in_subset | |
| inchi |
InChI=1S/C17H19NO3/c1-18-7-6-17-10-3-5-13(20)16(17)21-15-12(19)4-2-9(14(15)17)8-11(10)18/h2-5,10-11,13,16,19-20H,6-8H2,1H3/t10-,11+,13-,16-,17-/m0/s1 |
| inchikey |
BQJCRHHNABKAKU-KBQPJGBKSA-N |
| is conjugate base of | |
| label |
morphine |
| mass |
285.33770 |
| monoisotopicmass |
285.13649 |
| notation |
CHEBI:17303 |
| prefLabel |
morphine |
| smiles |
[H][C@]12C=C[C@H](O)[C@@H]3Oc4c(O)ccc5C[C@H]1N(C)CC[C@@]23c45 |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_50996 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50996 |