| Preferred Name |
7H-purine |
| Synonyms |
Purine 7H-purine Purine base |
| Definitions |
The 7H-tautomer of purine. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_17258 |
| charge |
0 |
| database_cross_reference |
Gmelin:601779 Beilstein:3200 KEGG:C15587 HMDB:HMDB0001366 Reaxys:3200 |
| definition |
The 7H-tautomer of purine. |
| formula |
C5H4N4 |
| has_alternative_id |
CHEBI:8639 CHEBI:14968 |
| has_exact_synonym |
7H-purine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Purine Purine base |
| id |
CHEBI:17258 |
| in_subset | |
| inchi |
InChI=1S/C5H4N4/c1-4-5(8-2-6-1)9-3-7-4/h1-3H,(H,6,7,8,9) |
| inchikey |
KDCGOANMDULRCW-UHFFFAOYSA-N |
| is tautomer of |
http://purl.obolibrary.org/obo/CHEBI_35588 |
| label |
7H-purine |
| mass |
120.11222 |
| monoisotopicmass |
120.04360 |
| notation |
CHEBI:17258 |
| prefLabel |
7H-purine |
| smiles |
c1ncc2[nH]cnc2n1 |
| treeView | |
| subClassOf |