| Preferred Name |
dopaminium(1+) |
| Synonyms |
2-(3,4-dihydroxyphenyl)ethan-1-aminium 2-(3,4-dihydroxyphenyl)ethanaminium dopamine dopaminium cation |
| Definitions |
An ammonium ion that is the conjugate acid of dopamine; major species at pH 7.3. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_59905 |
| charge |
+1 |
| database_cross_reference |
Gmelin:328863 |
| definition |
An ammonium ion that is the conjugate acid of dopamine; major species at pH 7.3. |
| formula |
C8H12NO2 |
| has role | |
| has_exact_synonym |
2-(3,4-dihydroxyphenyl)ethanaminium |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
2-(3,4-dihydroxyphenyl)ethan-1-aminium dopamine dopaminium cation |
| id |
CHEBI:59905 |
| in_subset | |
| inchi |
InChI=1S/C8H11NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,10-11H,3-4,9H2/p+1 |
| inchikey |
VYFYYTLLBUKUHU-UHFFFAOYSA-O |
| is conjugate acid of | |
| label |
dopaminium(1+) |
| mass |
154.18640 |
| monoisotopicmass |
154.08626 |
| notation |
CHEBI:59905 |
| prefLabel |
dopaminium(1+) |
| smiles |
[NH3+]CCc1ccc(O)c(O)c1 |
| treeView | |
| subClassOf |