loading...| Preferred Name |
clarithromycin |
| Synonyms |
clarithromycine 6-O-methylerythromycin A O(6)-methylerythromycin 6-O-methylerythromycin clarithromycina clarithromycinum CLA clarithromycin Clarithromycin CLARITHROMYCIN |
| Definitions |
The 6-O-methyl ether of erythromycin A, clarithromycin is a macrolide antibiotic used in the treatment of respiratory-tract, skin and soft-tissue infections. It is also used to eradicate Helicobacter pylori in the treatment of peptic ulcer disease. It prevents bacteria from growing by interfering with their protein synthesis. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_3732 |
| charge |
0 |
| database_cross_reference |
Beilstein:3581974 KEGG:C06912 CAS:81103-11-9 LINCS:LSM-5606 PDBeChem:CTY Reaxys:3581974 Patent:EP41355 DrugBank:DB01211 KEGG:D00276 Patent:US4331803 Drug_Central:668 PMID:16387493 LIPID_MAPS_instance:LMPK04000014 |
| definition |
The 6-O-methyl ether of erythromycin A, clarithromycin is a macrolide antibiotic used in the treatment of respiratory-tract, skin and soft-tissue infections. It is also used to eradicate Helicobacter pylori in the treatment of peptic ulcer disease. It prevents bacteria from growing by interfering with their protein synthesis. |
| formula |
C38H69NO13 |
| has role |
http://purl.obolibrary.org/obo/CHEBI_35703 http://purl.obolibrary.org/obo/CHEBI_36047 |
| has_alternative_id |
CHEBI:670147 CHEBI:442148 CHEBI:41676 |
| has_exact_synonym |
O(6)-methylerythromycin Clarithromycin CLARITHROMYCIN |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
clarithromycine 6-O-methylerythromycin A 6-O-methylerythromycin clarithromycina clarithromycinum CLA clarithromycin |
| id |
CHEBI:3732 |
| in_subset | |
| inchi |
InChI=1S/C38H69NO13/c1-15-26-38(10,45)31(42)21(4)28(40)19(2)17-37(9,47-14)33(52-35-29(41)25(39(11)12)16-20(3)48-35)22(5)30(23(6)34(44)50-26)51-27-18-36(8,46-13)32(43)24(7)49-27/h19-27,29-33,35,41-43,45H,15-18H2,1-14H3/t19-,20-,21+,22+,23-,24+,25+,26-,27+,29-,30+,31-,32+,33-,35+,36-,37-,38-/m1/s1 |
| inchikey |
AGOYDEPGAOXOCK-KCBOHYOISA-N |
| label |
clarithromycin |
| mass |
747.95340 |
| monoisotopicmass |
747.47689 |
| notation |
CHEBI:3732 |
| prefLabel |
clarithromycin |
| smiles |
[H][C@@]1(C[C@@](C)(OC)[C@@H](O)[C@H](C)O1)O[C@H]1[C@H](C)[C@@H](O[C@]2([H])O[C@H](C)C[C@@H]([C@H]2O)N(C)C)[C@@](C)(C[C@@H](C)C(=O)[C@H](C)[C@@H](O)[C@](C)(O)[C@@H](CC)OC(=O)[C@@H]1C)OC |
| treeView | |
| subClassOf |