loading...| Preferred Name |
methionine |
| Synonyms |
Methionin methionine Racemethionine 2-amino-4-(methylsulfanyl)butanoic acid Hmet Methionine 2-Amino-4-(methylthio)butyric acid alpha-amino-gamma-methylmercaptobutyric acid M Met metionina DL-Methionine 2-amino-4-(methylthio)butanoic acid |
| Definitions |
A sulfur-containing amino acid that is butyric acid bearing an amino substituent at position 2 and a methylthio substituent at position 4. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_16811 |
| charge |
0 |
| database_cross_reference |
KEGG:C01733 PMID:16702333 Beilstein:636185 KEGG:D04983 Reaxys:636185 UM-BBD_compID:c0094 PMID:2543976 CAS:59-51-8 Gmelin:3117 PMID:22264337 Wikipedia:Methionine |
| formula |
C5H11NO2S |
| has exact synonym |
methionine Methionine |
| has functional parent | |
| has role |
http://purl.obolibrary.org/obo/CHEBI_83056 http://purl.obolibrary.org/obo/CHEBI_76924 http://purl.obolibrary.org/obo/CHEBI_76971 |
| has_alternative_id |
CHEBI:14590 CHEBI:6829 CHEBI:25229 |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Methionin Racemethionine 2-amino-4-(methylsulfanyl)butanoic acid Hmet 2-Amino-4-(methylthio)butyric acid alpha-amino-gamma-methylmercaptobutyric acid M Met metionina DL-Methionine 2-amino-4-(methylthio)butanoic acid |
| id |
CHEBI:16811 |
| imported from | |
| in subset | |
| inchi |
InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| inchikey |
FFEARJCKVFRZRR-UHFFFAOYSA-N |
| is conjugate acid of | |
| is conjugate base of | |
| is tautomer of | |
| label |
methionine |
| mass |
149.21238 |
| monoisotopicmass |
149.05105 |
| notation |
CHEBI:16811 |
| prefLabel |
methionine |
| smiles |
CSCCC(N)C(O)=O |
| textual definition |
A sulfur-containing amino acid that is butyric acid bearing an amino substituent at position 2 and a methylthio substituent at position 4. |
| subClassOf |