| Preferred Name |
D-glutamate(1-) |
| Synonyms |
D-glutamate D-glutamic acid monoanion (2R)-2-ammoniopentanedioate D-glutamate(1-) hydrogen D-glutamate |
| Definitions |
An alpha-amino-acid anion that is the conjugate base of D-glutamic acid, having anionic carboxy groups and a cationic amino group |
| ID |
http://purl.obolibrary.org/obo/CHEBI_29986 |
| charge |
-1 |
| database_cross_reference |
Beilstein:8319427 MetaCyc:D-GLT |
| definition |
An alpha-amino-acid anion that is the conjugate base of D-glutamic acid, having anionic carboxy groups and a cationic amino group |
| formula |
C5H8NO4 |
| has_alternative_id |
CHEBI:12979 CHEBI:21022 |
| has_exact_synonym |
D-glutamate(1-) hydrogen D-glutamate |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
D-glutamate D-glutamic acid monoanion (2R)-2-ammoniopentanedioate |
| id |
CHEBI:29986 |
| in_subset | |
| inchi |
InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/p-1/t3-/m1/s1 |
| inchikey |
WHUUTDBJXJRKMK-GSVOUGTGSA-M |
| label |
D-glutamate(1-) |
| mass |
146.12136 |
| monoisotopicmass |
146.045 |
| notation |
CHEBI:29986 |
| prefLabel |
D-glutamate(1-) |
| smiles |
[NH3+][C@H](CCC([O-])=O)C([O-])=O |
| subClassOf |