loading...| Preferred Name |
acetate |
| Synonyms |
ethanoate Azetat MeCO2 anion CH3-COO(-) Ethanoat ACETATE ION acetic acid, ion(1-) acetate |
| Definitions |
A monocarboxylic acid anion resulting from the removal of a proton from the carboxy group of acetic acid. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_30089 |
| charge |
-1 |
| database_cross_reference |
MetaCyc:ACET Reaxys:1901470 PMID:22371380 CAS:71-50-1 Gmelin:1379 PMID:17190852 PMID:22211106 PDBeChem:ACT UM-BBD_compID:c0050 Wikipedia:Acetate DrugBank:DB03166 KEGG:C00033 Beilstein:1901470 |
| definition |
A monocarboxylic acid anion resulting from the removal of a proton from the carboxy group of acetic acid. |
| formula |
C2H3O2 |
| has_alternative_id |
CHEBI:13704 CHEBI:40480 CHEBI:22165 |
| has_exact_synonym |
acetate |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
ethanoate Azetat MeCO2 anion CH3-COO(-) Ethanoat ACETATE ION acetic acid, ion(1-) |
| id |
CHEBI:30089 |
| in_subset | |
| inchi |
InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/p-1 |
| inchikey |
QTBSBXVTEAMEQO-UHFFFAOYSA-M |
| label |
acetate |
| mass |
59.04402 |
| monoisotopicmass |
59.013 |
| notation |
CHEBI:30089 |
| prefLabel |
acetate |
| smiles |
CC([O-])=O |
| subClassOf |
http://purl.obolibrary.org/obo/GOCHE_75772 |