loading...| Preferred Name |
N(2)-(3,4-dichlorobenzoyl)-N,N-dipentyl-alpha-glutamine |
| Synonyms |
N(2)-(3,4-dichlorobenzoyl)-N,N-dipentyl-alpha-glutamine |
| Definitions |
A dicarboxylic acid monoamide obtained by formal condensation of the alpha-carboxy group of N-(3,4-dichlorobenzoyl)glutamic acid with the amino group of dipentylamine. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_88307 |
| charge |
0 |
| database_cross_reference |
LINCS:LSM-4389 |
| definition |
A dicarboxylic acid monoamide obtained by formal condensation of the alpha-carboxy group of N-(3,4-dichlorobenzoyl)glutamic acid with the amino group of dipentylamine. |
| formula |
C22H32Cl2N2O4 |
| has_exact_synonym |
N(2)-(3,4-dichlorobenzoyl)-N,N-dipentyl-alpha-glutamine |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:88307 |
| in_subset | |
| inchi |
InChI=1S/C22H32Cl2N2O4/c1-3-5-7-13-26(14-8-6-4-2)22(30)19(11-12-20(27)28)25-21(29)16-9-10-17(23)18(24)15-16/h9-10,15,19H,3-8,11-14H2,1-2H3,(H,25,29)(H,27,28) |
| inchikey |
IEKOTSCYBBDIJC-UHFFFAOYSA-N |
| label |
N(2)-(3,4-dichlorobenzoyl)-N,N-dipentyl-alpha-glutamine |
| mass |
459.407 |
| monoisotopicmass |
458.17391 |
| notation |
CHEBI:88307 |
| prefLabel |
N(2)-(3,4-dichlorobenzoyl)-N,N-dipentyl-alpha-glutamine |
| smiles |
ClC1=C(C=C(C(=O)NC(CCC(=O)O)C(N(CCCCC)CCCCC)=O)C=C1)Cl |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_22702 http://purl.obolibrary.org/obo/CHEBI_23697 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_22702 http://purl.obolibrary.org/obo/CHEBI_23697 |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||