loading...| Preferred Name |
efinaconazole |
| Synonyms |
efinaconazol efinaconazole (2R,3R)-2-(2,4-difluorophenyl)-3-(4-methylenepiperidin-1-yl)-1-(1H-1,2,4-triazol-1-yl)butan-2-ol JUBLIA efinaconazolum KP-103 |
| Definitions |
A member of the class of triazoles that is butan-2-ol which is substituted at positions 1, 2, and 3 by 1,2,4-triazol-1-yl, 2,4-difluorophenyl, and 4-methylenepiperidin-1-yl groups, respectively (the 2R,3R stereoisomer). It is an antifungal drug used for the topical treatment of onychomycosis (a nail infection caused mainly by dermatophytes). |
| ID |
http://purl.obolibrary.org/obo/CHEBI_82718 |
| charge |
0 |
| database_cross_reference |
PMID:23377392 PMID:24249649 PMID:24752277 PMID:24635354 PMID:25053979 Reaxys:8582880 PMID:23837154 PMID:24850511 PMID:23556032 PMID:23318803 PMID:25276275 PMID:25007364 PMID:25275736 KEGG:D10021 PMID:23177180 PMID:24800702 CAS:164650-44-6 PMID:25038564 Drug_Central:4874 PMID:24002148 PMID:24504588 PMID:24156162 PMID:25257931 PMID:24867968 PMID:24570290 PMID:24195094 PMID:25211303 Wikipedia:Efinaconazole PMID:23459486 |
| definition |
A member of the class of triazoles that is butan-2-ol which is substituted at positions 1, 2, and 3 by 1,2,4-triazol-1-yl, 2,4-difluorophenyl, and 4-methylenepiperidin-1-yl groups, respectively (the 2R,3R stereoisomer). It is an antifungal drug used for the topical treatment of onychomycosis (a nail infection caused mainly by dermatophytes). |
| formula |
C18H22F2N4O |
| has role | |
| has_exact_synonym |
(2R,3R)-2-(2,4-difluorophenyl)-3-(4-methylenepiperidin-1-yl)-1-(1H-1,2,4-triazol-1-yl)butan-2-ol |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
efinaconazol efinaconazole JUBLIA efinaconazolum KP-103 |
| id |
CHEBI:82718 |
| in_subset | |
| inchi |
InChI=1S/C18H22F2N4O/c1-13-5-7-23(8-6-13)14(2)18(25,10-24-12-21-11-22-24)16-4-3-15(19)9-17(16)20/h3-4,9,11-12,14,25H,1,5-8,10H2,2H3/t14-,18-/m1/s1 |
| inchikey |
NFEZZTICAUWDHU-RDTXWAMCSA-N |
| label |
efinaconazole |
| mass |
348.39030 |
| monoisotopicmass |
348.17617 |
| notation |
CHEBI:82718 |
| prefLabel |
efinaconazole |
| smiles |
C[C@@H](N1CCC(=C)CC1)[C@](O)(Cn1cncn1)c1ccc(F)cc1F |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_26151 http://purl.obolibrary.org/obo/CHEBI_50996 http://purl.obolibrary.org/obo/CHEBI_78840 http://purl.obolibrary.org/obo/CHEBI_87101 http://purl.obolibrary.org/obo/CHEBI_26878 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26151 http://purl.obolibrary.org/obo/CHEBI_50996 http://purl.obolibrary.org/obo/CHEBI_78840 http://purl.obolibrary.org/obo/CHEBI_87101 http://purl.obolibrary.org/obo/CHEBI_26878 |