loading...| Preferred Name |
naproxcinod |
| Synonyms |
(S)-2-(6-Methoxy-2-naphthyl)propanoic acid 4-nitrooxybutyl ester naproxcinodum HCT 3012 Naproxen-N-butyl nitrate Nitronaproxen 4-(nitrooxy)butyl (2S)-2-(6-methoxy-2-naphthyl)propanoate AZD3582 AZD 3582 naproxcinod |
| Definitions |
A carboxylic ester obtained by formal condensation of the carboxy group of naproxen with the hydroxy group of 4-(nitrooxy)butanol. A cyclooxygenase-inhibiting nitric oxide donator that is metabolised to naproxen and a nitric oxide donating moiety, effective in treatment of osteoarthritis. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_76254 |
| charge |
0 |
| database_cross_reference |
PMID:22425883 PMID:19392579 PMID:21542252 PMID:20202489 PMID:19411388 PMID:16784252 PMID:19557204 KEGG:D09568 PMID:19446261 PMID:17596112 Patent:US2008269323 PMID:21439116 PMID:19733721 Reaxys:8432594 PMID:21275896 CAS:163133-43-5 PMID:20828790 Patent:WO2012152438 PMID:23060406 PMID:22852285 Wikipedia:Naproxcinod Patent:WO2009000723 Drug_Central:4674 PMID:20677266 PMID:19798455 PMID:22870450 PMID:21545399 PMID:21272053 PMID:20722026 PMID:19393822 PMID:21756233 PMID:21371681 |
| definition |
A carboxylic ester obtained by formal condensation of the carboxy group of naproxen with the hydroxy group of 4-(nitrooxy)butanol. A cyclooxygenase-inhibiting nitric oxide donator that is metabolised to naproxen and a nitric oxide donating moiety, effective in treatment of osteoarthritis. |
| formula |
C18H21NO6 |
| has functional parent | |
| has role |
http://purl.obolibrary.org/obo/CHEBI_50266 http://purl.obolibrary.org/obo/CHEBI_35544 http://purl.obolibrary.org/obo/CHEBI_35475 |
| has_exact_synonym |
4-(nitrooxy)butyl (2S)-2-(6-methoxy-2-naphthyl)propanoate |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
(S)-2-(6-Methoxy-2-naphthyl)propanoic acid 4-nitrooxybutyl ester naproxcinodum HCT 3012 Naproxen-N-butyl nitrate Nitronaproxen AZD3582 AZD 3582 naproxcinod |
| id |
CHEBI:76254 |
| in_subset | |
| inchi |
InChI=1S/C18H21NO6/c1-13(18(20)24-9-3-4-10-25-19(21)22)14-5-6-16-12-17(23-2)8-7-15(16)11-14/h5-8,11-13H,3-4,9-10H2,1-2H3/t13-/m0/s1 |
| inchikey |
AKFJWRDCWYYTIG-ZDUSSCGKSA-N |
| label |
naproxcinod |
| mass |
347.36240 |
| monoisotopicmass |
347.13689 |
| notation |
CHEBI:76254 |
| prefLabel |
naproxcinod |
| smiles |
COc1ccc2cc(ccc2c1)[C@H](C)C(=O)OCCCCO[N+]([O-])=O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_48851 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_48851 |