| Preferred Name |
dopamine |
| Synonyms |
3,4-Dihydroxyphenethylamine 2-(3,4-Dihydroxyphenyl)ethylamine 4-(2-aminoethyl)-1,2-benzenediol 3-Hydroxytyramine 2-(3,4-dihydroxyphenyl)ethylamine Hydroxytyramin 4-(2-Aminoethyl)benzene-1,2-diol Dopamine dopaminum 4-(2-Aminoethyl)-1,2-benzenediol 4-(2-aminoethyl)catechol Deoxyepinephrine dopamina dopamine 4-(2-aminoethyl)benzene-1,2-diol 4-(2-aminoethyl)pyrocatechol |
| Definitions |
Catechol in which the hydrogen at position 4 is substituted by a 2-aminoethyl group. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_18243 |
| charge |
0 |
| database_cross_reference |
KNApSAcK:C00001408 PMID:9422813 LINCS:LSM-4630 MetaCyc:DOPAMINE KEGG:D07870 Reaxys:1072822 PMID:10629745 KEGG:C03758 Drug_Central:947 HMDB:HMDB0000073 CAS:51-61-6 PMID:11149432 DrugBank:DB00988 Wikipedia:Dopamine |
| definition |
Catechol in which the hydrogen at position 4 is substituted by a 2-aminoethyl group. |
| formula |
C8H11NO2 |
| has_alternative_id |
CHEBI:11695 CHEBI:23886 CHEBI:43686 CHEBI:11930 CHEBI:1764 CHEBI:14203 |
| has_exact_synonym |
Dopamine 4-(2-aminoethyl)benzene-1,2-diol |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
3,4-Dihydroxyphenethylamine 2-(3,4-Dihydroxyphenyl)ethylamine 4-(2-aminoethyl)-1,2-benzenediol 3-Hydroxytyramine 2-(3,4-dihydroxyphenyl)ethylamine Hydroxytyramin 4-(2-Aminoethyl)benzene-1,2-diol dopaminum 4-(2-Aminoethyl)-1,2-benzenediol 4-(2-aminoethyl)catechol Deoxyepinephrine dopamina dopamine 4-(2-aminoethyl)pyrocatechol |
| id |
CHEBI:18243 |
| in_subset | |
| inchi |
InChI=1S/C8H11NO2/c9-4-3-6-1-2-7(10)8(11)5-6/h1-2,5,10-11H,3-4,9H2 |
| inchikey |
VYFYYTLLBUKUHU-UHFFFAOYSA-N |
| label |
dopamine |
| mass |
153.17840 |
| monoisotopicmass |
153.079 |
| notation |
CHEBI:18243 |
| prefixIRI |
CHEBI:18243 |
| prefLabel |
dopamine |
| smiles |
NCCc1ccc(O)c(O)c1 |
| subClassOf |
http://purl.obolibrary.org/obo/GOCHE_76971 http://purl.obolibrary.org/obo/GOCHE_48560 http://purl.obolibrary.org/obo/GOCHE_38147 http://purl.obolibrary.org/obo/GOCHE_75771 http://purl.obolibrary.org/obo/GOCHE_35522 http://purl.obolibrary.org/obo/GOCHE_35524 |