loading...| Preferred Name |
glycine |
| Synonyms |
Glyzin Leimzucker Glycin aminoacetic acid glycine H2N-CH2-COOH Aminoessigsaeure G Glykokoll aminoethanoic acid Hgly GLYCINE Glycocoll Gly Aminoacetic acid Glycine |
| Definitions |
The simplest (and the only achiral) proteinogenic amino acid, with a hydrogen atom as its side chain. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_15428 |
| charge |
0 |
| database_cross_reference |
PMID:15388434 PMID:22401276 PMID:19028609 PMID:17970719 PMID:12631515 PMID:15710237 PMID:16986325 PMID:18816054 PMID:19544666 PMID:22044190 PMID:11542461 MetaCyc:GLY PMID:19449910 YMDB:YMDB00016 PMID:22234938 PMID:16901953 KEGG:D00011 PMID:11019925 HMDB:HMDB0000123 PMID:19526731 PMID:17154252 PMID:18396796 PMID:10930630 KEGG:C00037 Gmelin:1808 Reaxys:635782 PMID:18079355 PMID:16918424 PMID:22293292 PDBeChem:GLY PMID:12754315 PMID:17582620 PMID:18593588 ECMDB:ECMDB00123 PMID:16998855 PMID:21751272 PMID:12921899 PMID:19924257 DrugBank:DB00145 PMID:16151895 PMID:19120667 PMID:12770151 PMID:17383967 PMID:16417482 PMID:11174716 PMID:16105183 PMID:18840508 PMID:19738917 PMID:16664855 PMID:11806864 PMID:16214212 PMID:22079563 PMID:22264337 Drug_Central:1319 PMID:22434786 PMID:18440992 PMID:16444815 Beilstein:635782 CAS:56-40-6 Wikipedia:Glycine PMID:15331688 PMID:19916621 KNApSAcK:C00001361 |
| definition |
The simplest (and the only achiral) proteinogenic amino acid, with a hydrogen atom as its side chain. |
| formula |
C2H5NO2 |
| has_alternative_id |
CHEBI:10792 CHEBI:5460 CHEBI:42964 CHEBI:24368 CHEBI:14344 |
| has_exact_synonym |
aminoacetic acid glycine GLYCINE Glycine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
Glyzin Leimzucker Glycin H2N-CH2-COOH Aminoessigsaeure G Glykokoll aminoethanoic acid Hgly Glycocoll Gly Aminoacetic acid |
| id |
CHEBI:15428 |
| in_subset | |
| inchi |
InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5) |
| inchikey |
DHMQDGOQFOQNFH-UHFFFAOYSA-N |
| label |
glycine |
| mass |
75.06664 |
| monoisotopicmass |
75.03203 |
| notation |
CHEBI:15428 |
| prefLabel |
glycine |
| smiles |
NCC(O)=O |
| subClassOf |