loading...| Preferred Name |
cysteine |
| Synonyms |
2-Amino-3-mercaptopropionic acid Zystein C Cysteine 2-amino-3-sulfanylpropanoic acid Cystein 2-amino-3-mercaptopropanoic acid cisteina cysteine Cys Hcys |
| Definitions |
A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_15356 |
| charge |
0 |
| database_cross_reference |
KEGG:C00736 KNApSAcK:C00001351 Gmelin:2933 Wikipedia:Cysteine Reaxys:1721406 CAS:3374-22-9 PMID:17439666 Beilstein:1721406 PMID:25181601 KNApSAcK:C00007323 |
| definition |
A sulfur-containing amino acid that is propanoic acid with an amino group at position 2 and a sulfanyl group at position 3. |
| formula |
C3H7NO2S |
| has part | |
| has role | |
| has_alternative_id |
CHEBI:14061 CHEBI:4050 CHEBI:23508 |
| has_exact_synonym |
Cysteine cysteine |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
2-Amino-3-mercaptopropionic acid Zystein C 2-amino-3-sulfanylpropanoic acid Cystein 2-amino-3-mercaptopropanoic acid cisteina Cys Hcys |
| id |
CHEBI:15356 |
| in_subset | |
| inchi |
InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) |
| inchikey |
XUJNEKJLAYXESH-UHFFFAOYSA-N |
| is conjugate acid of | |
| is conjugate base of | |
| is tautomer of | |
| label |
cysteine |
| mass |
121.15922 |
| monoisotopicmass |
121.01975 |
| notation |
CHEBI:15356 |
| prefLabel |
cysteine |
| smiles |
NC(CS)C(O)=O |
| treeView |
http://purl.obolibrary.org/obo/CHEBI_26834 |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_26834 |