Jump to:
loading...| Preferred Name |
glutamate(1-) |
| Synonyms |
glutamate(1-) glutamate 2-ammoniopentanedioate hydrogen glutamate glutamic acid monoanion |
| Definitions |
An alpha-amino-acid anion that is the conjugate base of glutamic acid, having anionic carboxy groups and a cationic amino group |
| ID |
http://purl.obolibrary.org/obo/CHEBI_14321 |
| charge |
-1 |
| database_cross_reference |
Gmelin:327908 |
| definition |
An alpha-amino-acid anion that is the conjugate base of glutamic acid, having anionic carboxy groups and a cationic amino group |
| formula |
C5H8NO4 |
| has exact synonym |
glutamate(1-) hydrogen glutamate |
| has related synonym |
glutamate 2-ammoniopentanedioate glutamic acid monoanion |
| has role | |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:14321 |
| in_subset | |
| inchi |
InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/p-1 |
| inchikey |
WHUUTDBJXJRKMK-UHFFFAOYSA-M |
| is_conjugate_acid_of | |
| is_conjugate_base_of | |
| label |
glutamate(1-) |
| mass |
146.12136 |
| monoisotopicmass |
146.04588 |
| notation |
CHEBI:14321 |
| prefLabel |
glutamate(1-) |
| smiles |
[NH3+]C(CCC([O-])=O)C([O-])=O |
| subClassOf |
Create New Mapping