loading...| Preferred Name |
p-tolyl beta-D-glucuronide(1-) |
| Synonyms |
p-cresol glucuronidate p-cresyl glucuronide(1-) p-cresol glucuronide(1-) p-cresyl beta-D-glucuronidate p-cresyl glucuronidate p-cresol beta-D-glucuronidate p-cresyl beta-D-glucuronide(1-) 4-methylphenyl beta-D-glucopyranosiduronate p-cresol beta-D-glucuronide(1-) p-tolyl beta-D-glucuronidate |
| Definitions |
A carbohydrate acid derivative anion resulting from the removal of a proton from the carboxy group of p-tolyl beta-D-glucuronide. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_133576 |
| charge |
-1 |
| definition |
A carbohydrate acid derivative anion resulting from the removal of a proton from the carboxy group of p-tolyl beta-D-glucuronide. |
| formula |
C13H15O7 |
| has role | |
| has_exact_synonym |
4-methylphenyl beta-D-glucopyranosiduronate |
| has_obo_namespace |
chebi_ontology |
| has_related_synonym |
p-cresol glucuronidate p-cresyl glucuronide(1-) p-cresol glucuronide(1-) p-cresyl beta-D-glucuronidate p-cresyl glucuronidate p-cresol beta-D-glucuronidate p-cresyl beta-D-glucuronide(1-) p-cresol beta-D-glucuronide(1-) p-tolyl beta-D-glucuronidate |
| id |
CHEBI:133576 |
| in_subset | |
| inchi |
InChI=1S/C13H16O7/c1-6-2-4-7(5-3-6)19-13-10(16)8(14)9(15)11(20-13)12(17)18/h2-5,8-11,13-16H,1H3,(H,17,18)/p-1/t8-,9-,10+,11-,13+/m0/s1 |
| inchikey |
JPAUCQAJHLSMQW-XPORZQOISA-M |
| is conjugate base of | |
| label |
p-tolyl beta-D-glucuronide(1-) |
| mass |
283.255 |
| monoisotopicmass |
283.08233 |
| notation |
CHEBI:133576 |
| prefLabel |
p-tolyl beta-D-glucuronide(1-) |
| smiles |
O1[C@@H]([C@@H](O)[C@H](O)[C@@H](O)[C@@H]1OC2=CC=C(C=C2)C)C([O-])=O |
| treeView | |
| subClassOf |
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| There are currently no mappings for this class. | |||