loading...| Preferred Name |
progesterone |
| Synonyms |
Gelbkoerperhormon progesterone 17alpha-progesterone PROGESTERONE (S)-Progesterone 4-Pregnene-3,20-dione Delta(4)-pregnene-3,20-dione (S)-Pregn-4-en-3,20-dione pregn-4-ene-3,20-dione Agolutin Progesterone (S)-4-Pregnene-3,20-dione Akrolutin Progesteron corpus luteum hormone Crinone luteohormone |
| Definitions |
A C21-steroid hormone in which a pregnane skeleton carries oxo substituents at positions 3 and 20 and is unsaturated at C(4)-C(5). As a hormone, it is involved in the female menstrual cycle, pregnancy and embryogenesis of humans and other species. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_17026 |
| charge |
0 |
| database_cross_reference |
KEGG:C00410 Beilstein:1915950 Reaxys:1915950 PMID:9506942 Drug_Central:2279 PMID:10438974 Gmelin:708590 CAS:57-83-0 KEGG:D00066 MetaCyc:PROGESTERONE PDBeChem:STR DrugBank:DB00396 HMDB:HMDB0001830 Wikipedia:Progesterone |
| definition |
A C21-steroid hormone in which a pregnane skeleton carries oxo substituents at positions 3 and 20 and is unsaturated at C(4)-C(5). As a hormone, it is involved in the female menstrual cycle, pregnancy and embryogenesis of humans and other species. |
| formula |
C21H30O2 |
| has exact synonym |
progesterone PROGESTERONE pregn-4-ene-3,20-dione Progesterone |
| has related synonym |
Gelbkoerperhormon 17alpha-progesterone (S)-Progesterone 4-Pregnene-3,20-dione Delta(4)-pregnene-3,20-dione (S)-Pregn-4-en-3,20-dione Agolutin (S)-4-Pregnene-3,20-dione Akrolutin Progesteron corpus luteum hormone Crinone luteohormone |
| has role |
http://purl.obolibrary.org/obo/CHEBI_75771 http://purl.obolibrary.org/obo/CHEBI_77746 http://purl.obolibrary.org/obo/CHEBI_59826 |
| has_alternative_id |
CHEBI:14896 CHEBI:439 CHEBI:26269 CHEBI:18798 CHEBI:45786 CHEBI:8453 |
| has_obo_namespace |
chebi_ontology |
| has_parent_hydride | |
| id |
CHEBI:17026 |
| in_subset | |
| inchi |
InChI=1S/C21H30O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19H,4-11H2,1-3H3/t16-,17+,18-,19-,20-,21+/m0/s1 |
| inchikey |
RJKFOVLPORLFTN-LEKSSAKUSA-N |
| label |
progesterone |
| mass |
314.46170 |
| monoisotopicmass |
314.22458 |
| notation |
CHEBI:17026 |
| prefLabel |
progesterone |
| smiles |
[H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@H](CC[C@@]21[H])C(C)=O |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_47909 |