loading...| Preferred Name |
testosterone |
| Synonyms |
17beta-hydroxy-4-androsten-3-one testosterona Testosteron testosteronum 17beta-Hydroxy-4-androsten-3-one Testosterone Androderm 4-androsten-17beta-ol-3-one TESTOSTERONE 17beta-hydroxyandrost-4-en-3-one testosterone |
| Definitions |
An androstanoid having 17beta-hydroxy and 3-oxo groups, together with unsaturation at C-4-C-5.. |
| ID |
http://purl.obolibrary.org/obo/CHEBI_17347 |
| charge |
0 |
| database_cross_reference |
Gmelin:538843 CAS:58-22-0 KNApSAcK:C00003675 DrugBank:DB00624 Beilstein:1915399 KEGG:C00535 PMID:18900503 KEGG:D00075 PMID:10438974 PMID:11786693 LIPID_MAPS_instance:LMST02020002 Reaxys:1915399 Drug_Central:2607 Beilstein:3653705 PDBeChem:TES Wikipedia:Testosterone HMDB:HMDB0000234 PMID:24498482 |
| definition |
An androstanoid having 17beta-hydroxy and 3-oxo groups, together with unsaturation at C-4-C-5.. |
| formula |
C19H28O2 |
| has exact synonym |
Testosterone TESTOSTERONE 17beta-hydroxyandrost-4-en-3-one testosterone |
| has related synonym |
17beta-hydroxy-4-androsten-3-one testosterona Testosteron testosteronum 17beta-Hydroxy-4-androsten-3-one Androderm 4-androsten-17beta-ol-3-one testosterone |
| has role |
http://purl.obolibrary.org/obo/CHEBI_50113 http://purl.obolibrary.org/obo/CHEBI_75771 |
| has_alternative_id |
CHEBI:45798 CHEBI:15214 CHEBI:26883 CHEBI:9461 |
| has_obo_namespace |
chebi_ontology |
| id |
CHEBI:17347 |
| in_subset | |
| inchi |
InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1 |
| inchikey |
MUMGGOZAMZWBJJ-DYKIIFRCSA-N |
| label |
testosterone |
| mass |
288.42440 |
| monoisotopicmass |
288.20893 |
| notation |
CHEBI:17347 |
| prefLabel |
testosterone |
| smiles |
[H][C@@]12CCC3=CC(=O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| subClassOf |
http://purl.obolibrary.org/obo/CHEBI_50402 http://purl.obolibrary.org/obo/CHEBI_131621 |